N'-(4-hydroxy-3-(trifluoromethyl)benzoyl)-3,4-diphenylfuran-2-carbohydrazide

ID: ALA3326174

PubChem CID: 68862614

Max Phase: Preclinical

Molecular Formula: C25H17F3N2O4

Molecular Weight: 466.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NNC(=O)c1occ(-c2ccccc2)c1-c1ccccc1)c1ccc(O)c(C(F)(F)F)c1

Standard InChI:  InChI=1S/C25H17F3N2O4/c26-25(27,28)19-13-17(11-12-20(19)31)23(32)29-30-24(33)22-21(16-9-5-2-6-10-16)18(14-34-22)15-7-3-1-4-8-15/h1-14,31H,(H,29,32)(H,30,33)

Standard InChI Key:  YFKJFXJIVQHGHP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    6.3009  -24.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2997  -25.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0078  -25.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7174  -25.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7146  -24.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0060  -23.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5921  -25.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8458  -25.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2985  -25.8907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7066  -26.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5060  -26.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1113  -26.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9392  -27.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5453  -28.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3237  -28.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4925  -27.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8851  -26.7230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3737  -27.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5609  -27.4299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8535  -28.0065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2280  -28.1762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4152  -28.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0823  -29.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9353  -27.5996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2691  -29.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9362  -29.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4162  -30.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2329  -30.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5621  -29.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0843  -31.2419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1243  -29.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3628  -29.2555    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2120  -30.6634    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6686  -30.1246    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  2  7  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 12  1  0
 10 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 27 30  1  0
 26 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Associated Targets(non-human)

Gcgr Glucagon receptor (262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.42Molecular Weight (Monoisotopic): 466.1140AlogP: 5.41#Rotatable Bonds: 4
Polar Surface Area: 91.57Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.07CX Basic pKa: CX LogP: 5.02CX LogD: 4.52
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.50

References

1. Hasegawa F, Niidome K, Migihashi C, Murata M, Negoro T, Matsumoto T, Kato K, Fujii A..  (2014)  Discovery of furan-2-carbohydrazides as orally active glucagon receptor antagonists.,  24  (17): [PMID:25127101] [10.1016/j.bmcl.2014.07.025]

Source