N'-(6-hydroxybiphenylcarbonyl)-3,4-diphenylfuran-2-carbohydrazide

ID: ALA3326177

PubChem CID: 68863701

Max Phase: Preclinical

Molecular Formula: C30H22N2O4

Molecular Weight: 474.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NNC(=O)c1occ(-c2ccccc2)c1-c1ccccc1)c1ccc(O)c(-c2ccccc2)c1

Standard InChI:  InChI=1S/C30H22N2O4/c33-26-17-16-23(18-24(26)20-10-4-1-5-11-20)29(34)31-32-30(35)28-27(22-14-8-3-9-15-22)25(19-36-28)21-12-6-2-7-13-21/h1-19,33H,(H,31,34)(H,32,35)

Standard InChI Key:  QPZXJVVKDGOAEQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   28.9222  -24.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9211  -24.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6291  -25.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3388  -24.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3359  -24.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6273  -23.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2134  -25.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4671  -24.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9199  -25.5027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3279  -26.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1273  -26.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7326  -26.5872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5606  -27.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1667  -27.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9450  -27.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1138  -26.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5064  -26.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9950  -26.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1822  -27.0419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4749  -27.6185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8493  -27.7882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0365  -27.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7036  -28.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5567  -27.2116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8905  -28.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5575  -29.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0376  -30.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8543  -30.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1834  -29.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7056  -30.8540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7473  -29.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2682  -28.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4561  -28.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1221  -29.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6062  -30.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4166  -30.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  2  7  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 12  1  0
 10 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 27 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 26 31  1  0
M  END

Associated Targets(non-human)

Gcgr Glucagon receptor (262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.52Molecular Weight (Monoisotopic): 474.1580AlogP: 6.06#Rotatable Bonds: 5
Polar Surface Area: 91.57Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.44CX Basic pKa: CX LogP: 5.79CX LogD: 5.53
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -0.25

References

1. Hasegawa F, Niidome K, Migihashi C, Murata M, Negoro T, Matsumoto T, Kato K, Fujii A..  (2014)  Discovery of furan-2-carbohydrazides as orally active glucagon receptor antagonists.,  24  (17): [PMID:25127101] [10.1016/j.bmcl.2014.07.025]

Source