N'-(4-hydroxy-3-nitrobenzoyl)-3-(4-isopropylphenyl)furan-2-carbohydrazide

ID: ALA3326186

PubChem CID: 11704225

Max Phase: Preclinical

Molecular Formula: C21H19N3O6

Molecular Weight: 409.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1ccc(-c2ccoc2C(=O)NNC(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1

Standard InChI:  InChI=1S/C21H19N3O6/c1-12(2)13-3-5-14(6-4-13)16-9-10-30-19(16)21(27)23-22-20(26)15-7-8-18(25)17(11-15)24(28)29/h3-12,25H,1-2H3,(H,22,26)(H,23,27)

Standard InChI Key:  LXZWYGKYMHGWRT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.2537   -5.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5074   -5.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9601   -5.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3681   -6.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1676   -6.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7728   -7.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6008   -7.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2069   -8.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9853   -8.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1541   -7.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5466   -6.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0352   -7.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2225   -7.5160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5151   -8.0926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8895   -8.2623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0768   -8.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7439   -9.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5969   -7.6857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9307   -9.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5978   -9.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0778  -10.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8945  -10.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2237   -9.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7459  -11.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2168  -10.0052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5450  -10.7519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7009   -9.3485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929   -8.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4234   -9.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3699   -8.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
  4 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 21 24  1  0
 20 25  1  0
 25 26  2  0
 25 27  1  0
  9 28  1  0
 28 29  1  0
 28 30  1  0
M  CHG  2  25   1  27  -1
M  END

Associated Targets(non-human)

Gcgr Glucagon receptor (262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.40Molecular Weight (Monoisotopic): 409.1274AlogP: 3.76#Rotatable Bonds: 5
Polar Surface Area: 134.71Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.75CX Basic pKa: CX LogP: 3.68CX LogD: 1.86
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -1.05

References

1. Hasegawa F, Niidome K, Migihashi C, Murata M, Negoro T, Matsumoto T, Kato K, Fujii A..  (2014)  Discovery of furan-2-carbohydrazides as orally active glucagon receptor antagonists.,  24  (17): [PMID:25127101] [10.1016/j.bmcl.2014.07.025]

Source