The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-{2-[(2S,3R)-2-((2S,3S)-2-Acetylamino-3-methyl-pentanoylamino)-3-hydroxy-butyrylamino]-acetylamino}-4-hydroxy-2-oxo-butyrylamino)-propionic acid ID: ALA3326344
PubChem CID: 118711579
Max Phase: Preclinical
Molecular Formula: C21H37N5O9
Molecular Weight: 503.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C(=O)NCC(=O)NC(CO)C(=O)C(=O)NCCCO)[C@@H](C)O
Standard InChI: InChI=1S/C21H37N5O9/c1-5-11(2)16(24-13(4)30)20(34)26-17(12(3)29)19(33)23-9-15(31)25-14(10-28)18(32)21(35)22-7-6-8-27/h11-12,14,16-17,27-29H,5-10H2,1-4H3,(H,22,35)(H,23,33)(H,24,30)(H,25,31)(H,26,34)/t11-,12+,14?,16-,17-/m0/s1
Standard InChI Key: BJGAULNLGODBJV-XETWEVHHSA-N
Molfile:
RDKit 2D
35 34 0 0 0 0 0 0 0 0999 V2000
2.8056 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5220 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6636 -12.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6659 -12.5621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3794 -10.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3786 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5220 -13.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8055 -13.3864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0940 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6664 -12.1484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9519 -11.3222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0909 -12.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3776 -12.5621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9519 -12.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9543 -13.3849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3800 -12.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2383 -13.7932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8031 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0916 -12.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2402 -12.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0574 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6636 -11.3222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0940 -13.3871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5238 -12.1473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2402 -11.3222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9519 -13.7975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3794 -10.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8079 -12.1473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9543 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8038 -10.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2379 -13.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8056 -13.3871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0916 -11.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5238 -13.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2379 -12.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 1 1 0
2 20 1 0
35 24 1 6
17 7 1 0
29 10 1 0
2 7 1 0
3 22 2 0
9 28 1 0
6 12 1 0
33 30 1 6
1 32 2 0
20 29 1 0
35 31 1 0
19 33 1 0
4 16 1 0
12 18 1 0
9 23 2 0
3 13 1 0
33 5 1 0
35 14 1 0
18 8 1 0
31 26 1 6
21 3 1 0
16 9 1 0
10 6 1 0
14 11 2 0
1 24 1 0
14 4 1 0
31 34 1 0
28 2 1 0
19 13 1 1
29 15 2 0
20 25 2 0
5 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.55Molecular Weight (Monoisotopic): 503.2591AlogP: -3.94#Rotatable Bonds: 16Polar Surface Area: 223.26Molecular Species: NEUTRALHBA: 9HBD: 8#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.46CX Basic pKa: ┄CX LogP: -4.21CX LogD: -4.21Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.08Np Likeness Score: -0.02
References 1. Kher SS, Penzo M, Fulle S, Finn PW, Blackman MJ, Jirgensons A.. (2014) Substrate derived peptidic α-ketoamides as inhibitors of the malarial protease PfSUB1., 24 (18): [PMID:25129616 ] [10.1016/j.bmcl.2014.07.086 ]