(4S,7S)-4-sec-butyl-7-((R)-1-hydroxyethyl)-13-isopropyl-2,5,8,11,14,15-hexaoxo-3,6,9,12,16-pentaazanonadecan-19-oic acid

ID: ALA3326345

PubChem CID: 118711580

Max Phase: Preclinical

Molecular Formula: C23H39N5O9

Molecular Weight: 529.59

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C(=O)NCC(=O)NC(C(=O)C(=O)NCCC(=O)O)C(C)C)[C@@H](C)O

Standard InChI:  InChI=1S/C23H39N5O9/c1-7-12(4)18(26-14(6)30)22(36)28-19(13(5)29)21(35)25-10-15(31)27-17(11(2)3)20(34)23(37)24-9-8-16(32)33/h11-13,17-19,29H,7-10H2,1-6H3,(H,24,37)(H,25,35)(H,26,30)(H,27,31)(H,28,36)(H,32,33)/t12-,13+,17?,18-,19-/m0/s1

Standard InChI Key:  RZSOCXYOVGCIKK-CNNKAVGXSA-N

Molfile:  

     RDKit          2D

 37 36  0  0  0  0  0  0  0  0999 V2000
    2.4652   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1809   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3233   -4.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3251   -4.6589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0391   -3.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0372   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1809   -5.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4638   -5.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7530   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3250   -4.2453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6111   -3.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7493   -4.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0373   -4.6589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1760   -4.2467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6111   -4.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6129   -5.4817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0390   -4.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8970   -5.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4614   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7512   -4.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8989   -4.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3975   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3233   -3.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7530   -5.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1832   -4.2442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8989   -3.4192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6111   -5.8942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0391   -2.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4669   -4.2442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6129   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4633   -3.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8972   -5.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4652   -5.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7512   -3.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1832   -5.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8972   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4712   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 20  1  1  0
  2 21  1  0
 36 25  1  6
 18  7  1  0
 30 10  1  0
  2  7  1  0
  3 23  2  0
  9 29  1  0
  6 12  1  0
 34 31  1  6
  1 33  2  0
 21 30  1  0
 36 32  1  0
 20 34  1  0
  4 17  1  0
 12 19  1  0
  9 24  2  0
 19 14  2  0
  3 13  1  0
 34  5  1  0
 36 15  1  0
 19  8  1  0
 32 27  1  6
 22  3  1  0
 17  9  1  0
 10  6  1  0
 15 11  2  0
  1 25  1  0
 15  4  1  0
 32 35  1  0
 29  2  1  0
 20 13  1  1
 30 16  2  0
 21 26  2  0
  5 28  1  0
  7 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3326345

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 529.59

Molecular Weight (Monoisotopic): 529.2748

AlogP: -2.18

#Rotatable Bonds: 16

Polar Surface Area: 220.10

Molecular Species: ACID

HBA: 8

HBD: 7

#RO5 Violations: 2

HBA (Lipinski): 14

HBD (Lipinski): 7

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 4.09

CX Basic pKa: ┄

CX LogP: -1.93

CX LogD: -5.03

Aromatic Rings: ┄

Heavy Atoms: 37

QED Weighted: 0.11

Np Likeness Score: -0.15

References

1. Kher SS, Penzo M, Fulle S, Finn PW, Blackman MJ, Jirgensons A..  (2014)  Substrate derived peptidic α-ketoamides as inhibitors of the malarial protease PfSUB1.,  24  (18): [PMID:25129616] [10.1016/j.bmcl.2014.07.086]

Source

Source(1):

• Scientific Literature