2-Acetoxymethyl-4-(5-benzyloxycarbonylamino-6-oxo-2-phenyl-6H-pyrimidin-1-yl)-but-2-enoic acid methyl ester

ID: ALA332746

PubChem CID: 10435716

Max Phase: Preclinical

Molecular Formula: C26H25N3O7

Molecular Weight: 491.50

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)/C(=C/Cn1c(-c2ccccc2)ncc(NC(=O)OCc2ccccc2)c1=O)COC(C)=O

Standard InChI:  InChI=1S/C26H25N3O7/c1-18(30)35-17-21(25(32)34-2)13-14-29-23(20-11-7-4-8-12-20)27-15-22(24(29)31)28-26(33)36-16-19-9-5-3-6-10-19/h3-13,15H,14,16-17H2,1-2H3,(H,28,33)/b21-13+

Standard InChI Key:  KRDBJCISAUXTLS-FYJGNVAPSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    6.5417   -6.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1167   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -6.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -5.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8167   -4.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6792   -6.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1042   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042   -6.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -6.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875   -6.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9667   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3917   -6.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -7.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2500   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1875   -8.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6875   -7.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6792   -5.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3917   -5.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9750   -6.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4042   -7.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7667   -9.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1125   -6.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2542   -6.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3875   -8.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9625   -5.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8250   -6.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -6.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -7.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9500   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6750   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -7.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -7.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  1  0
  5  4  2  0
  6 11  2  0
  7  5  1  0
  8  2  1  0
  9  1  1  0
 10  8  1  0
 11  9  1  0
 12  6  1  0
 13  3  2  0
 14  4  1  0
 15 20  1  0
 16  6  1  0
 17 10  2  0
 18 12  2  0
 19 10  1  0
 20 16  1  0
 21 15  2  0
 22 12  1  0
 23 19  1  0
 24 23  1  0
 25 15  1  0
 26 14  1  0
 27 14  2  0
 28 22  1  0
 29 24  2  0
 30 24  1  0
 31 26  2  0
 32 27  1  0
 33 29  1  0
 34 30  2  0
 35 34  1  0
 36 32  2  0
  7  2  2  0
 31 36  1  0
 33 35  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA332746

   methyl (E)-2-(acetyloxymethyl)-4-[6-oxo-2-phenyl-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl]but-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 491.50

Molecular Weight (Monoisotopic): 491.1693

AlogP: 3.32

#Rotatable Bonds: 9

Polar Surface Area: 125.82

Molecular Species: NEUTRAL

HBA: 9

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 10

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 11.19

CX Basic pKa: 0.50

CX LogP: 2.94

CX LogD: 2.94

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.27

Np Likeness Score: -0.23

References

1. Zhu S, Hudson TH, Kyle DE, Lin AJ..  (2002)  Synthesis and in vitro studies of novel pyrimidinyl peptidomimetics as potential antimalarial therapeutic agents.,  45  (16): [PMID:12139460] [10.1021/jm020104f]

Source

Source(1):

• Scientific Literature