1-((8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-phenylprop-2-en-1-one

ID: ALA3329264

PubChem CID: 118712278

Max Phase: Preclinical

Molecular Formula: C28H36O2

Molecular Weight: 404.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CC=C4CC(O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)/C=C/c1ccccc1

Standard InChI:  InChI=1S/C28H36O2/c1-27-16-14-21(29)18-20(27)9-10-22-23-11-12-25(28(23,2)17-15-24(22)27)26(30)13-8-19-6-4-3-5-7-19/h3-9,13,21-25,29H,10-12,14-18H2,1-2H3/b13-8+/t21?,22-,23-,24-,25+,27-,28-/m0/s1

Standard InChI Key:  KMYNFJUNXFDOIP-ZOARZMQZSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    1.6096  -16.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6096  -17.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3149  -18.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3149  -16.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0202  -16.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0212  -17.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7255  -18.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4333  -17.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7235  -16.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4303  -16.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4291  -15.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7198  -15.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1359  -15.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1373  -16.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9144  -16.7066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3933  -16.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9121  -15.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1632  -14.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9622  -14.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6153  -14.0014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5101  -15.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3092  -14.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8543  -15.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6527  -15.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9045  -14.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3518  -13.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5555  -14.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9025  -18.0907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0129  -16.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1301  -14.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7186  -17.2683    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1301  -17.2725    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4244  -16.0425    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  2  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 17 18  1  1
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  2 28  1  0
  5 29  1  1
 13 30  1  1
  9 31  1  6
 14 32  1  6
 10 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3329264

    ---

Associated Targets(non-human)

Penicillium chrysogenum (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bacillus subtilis (32866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.59Molecular Weight (Monoisotopic): 404.2715AlogP: 6.21#Rotatable Bonds: 3
Polar Surface Area: 37.30Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.94CX LogD: 5.94
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: 2.02

References

1. Singh P, Anand A, Kumar V..  (2014)  Recent developments in biological activities of chalcones: a mini review.,  85  [PMID:25137491] [10.1016/j.ejmech.2014.08.033]

Source