The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Fluorophenyl)-2-(4-(3-phenyl-1,2,4-triazolo[3,4-a]phthalazin-6-yl)piperazin-1-yl)acetamide ID: ALA3330922
PubChem CID: 87056627
Max Phase: Preclinical
Molecular Formula: C27H24FN7O
Molecular Weight: 481.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN1CCN(c2nn3c(-c4ccccc4)nnc3c3ccccc23)CC1)Nc1ccccc1F
Standard InChI: InChI=1S/C27H24FN7O/c28-22-12-6-7-13-23(22)29-24(36)18-33-14-16-34(17-15-33)27-21-11-5-4-10-20(21)26-31-30-25(35(26)32-27)19-8-2-1-3-9-19/h1-13H,14-18H2,(H,29,36)
Standard InChI Key: OOVDMOCNBMMNNZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
9.3574 -9.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6463 -10.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0686 -10.3630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3574 -9.1313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9351 -9.9524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2240 -10.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -9.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -9.1313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2240 -8.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9351 -9.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3794 -7.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3794 -8.7207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0905 -9.1313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8017 -8.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8017 -7.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -7.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -6.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8017 -6.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0905 -6.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0905 -7.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1157 -8.3101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5984 -7.6458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5984 -8.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3446 -9.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8941 -10.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6404 -11.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8371 -11.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2877 -10.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5414 -9.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0686 -8.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0686 -7.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7797 -7.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4909 -7.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4909 -8.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7797 -9.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3574 -7.4889 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
5 10 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
11 20 1 0
15 20 2 0
21 22 1 0
21 23 2 0
11 22 2 0
12 23 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
23 24 1 0
8 14 1 0
2 5 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
31 36 1 0
4 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.54Molecular Weight (Monoisotopic): 481.2026AlogP: 3.84#Rotatable Bonds: 5Polar Surface Area: 78.66Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.55CX Basic pKa: 5.53CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -2.08
References 1. Xue DQ, Zhang XY, Wang CJ, Ma LY, Zhu N, He P, Shao KP, Chen PJ, Gu YF, Zhang XS, Wang CF, Ji CH, Zhang QR, Liu HM.. (2014) Synthesis and anticancer activities of novel 1,2,4-triazolo[3,4-a]phthalazine derivatives., 85 [PMID:25086915 ] [10.1016/j.ejmech.2014.07.031 ]