The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-O-Acetylaltersolanol L ID: ALA3335043
PubChem CID: 118714205
Max Phase: Preclinical
Molecular Formula: C18H22O8
Molecular Weight: 366.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(c1)[C@H](O)[C@@H]1[C@H](C[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]1O)C2=O
Standard InChI: InChI=1S/C18H22O8/c1-7(19)26-12-6-10-14(17(23)18(12,2)24)16(22)9-4-8(25-3)5-11(20)13(9)15(10)21/h4-5,10,12,14,16-17,20,22-24H,6H2,1-3H3/t10-,12+,14-,16-,17+,18+/m0/s1
Standard InChI Key: JOCYAISYJVQQMF-LGYFHBSQSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
19.5342 -2.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5330 -3.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2449 -3.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2431 -1.9582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9555 -2.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9590 -3.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6752 -3.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6684 -1.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1066 -3.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8267 -3.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8256 -2.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1045 -1.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3881 -2.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3902 -3.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6655 -1.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6773 -4.4265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1013 -1.1194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5382 -3.6001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2286 -1.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6436 -2.3569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8226 -1.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8224 -1.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2434 -4.4260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5381 -4.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2495 -4.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8265 -4.8325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3881 -1.5378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.3902 -4.0161 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 14 1 0
13 8 1 0
13 12 1 0
14 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
14 13 1 0
8 15 1 6
7 16 2 0
12 17 1 1
10 18 1 6
11 19 1 1
11 20 1 0
1 21 1 0
21 22 1 0
3 23 1 0
18 24 1 0
24 25 1 0
24 26 2 0
13 27 1 6
14 28 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 366.37Molecular Weight (Monoisotopic): 366.1315AlogP: 0.31#Rotatable Bonds: 2Polar Surface Area: 133.52Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.49CX Basic pKa: ┄CX LogP: -0.20CX LogD: -0.23Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: 2.53
References 1. Zhou XM, Zheng CJ, Chen GY, Song XP, Han CR, Li GN, Fu YH, Chen WH, Niu ZG.. (2014) Bioactive anthraquinone derivatives from the mangrove-derived fungus Stemphylium sp. 33231., 77 (9): [PMID:25136754 ] [10.1021/np500340y ]