The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(Adamantan-1-ylethynyl)phenyl)-4-(((S)-4-((6-(methoxymethyl)pyridin-3-yl)methyl)-2-methylpiperazin-1-yl)methyl)benzamide ID: ALA3335427
PubChem CID: 118714452
Max Phase: Preclinical
Molecular Formula: C39H46N4O2
Molecular Weight: 602.82
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCc1ccc(CN2CCN(Cc3ccc(C(=O)Nc4ccc(C#CC56CC7CC(CC(C7)C5)C6)cc4)cc3)[C@@H](C)C2)cn1
Standard InChI: InChI=1S/C39H46N4O2/c1-28-24-42(25-31-7-12-37(27-45-2)40-23-31)15-16-43(28)26-30-3-8-35(9-4-30)38(44)41-36-10-5-29(6-11-36)13-14-39-20-32-17-33(21-39)19-34(18-32)22-39/h3-12,23,28,32-34H,15-22,24-27H2,1-2H3,(H,41,44)/t28-,32?,33?,34?,39?/m0/s1
Standard InChI Key: WGKHIIOJTRYMFF-LIZUPSOTSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
15.0840 -12.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4146 -11.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8708 -11.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6832 -10.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1797 -10.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5085 -9.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0305 -11.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3815 -10.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6267 -11.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6975 -9.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0024 -7.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2947 -7.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2935 -8.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7205 -8.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7177 -7.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4448 -8.2465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8741 -7.4317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1576 -8.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -8.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1594 -7.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4315 -8.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4490 -7.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8718 -8.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5843 -7.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1396 -8.2575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8470 -8.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8441 -9.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5506 -9.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2596 -9.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2578 -8.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5507 -8.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4308 -9.4826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9675 -9.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6739 -10.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7348 -8.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7328 -9.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0282 -9.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0258 -10.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7302 -11.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4383 -10.6883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4372 -9.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5786 -8.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -11.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0210 -12.3228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0201 -13.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
12 24 1 0
19 14 2 0
15 11 2 0
11 12 1 0
17 20 1 0
14 15 1 0
14 21 1 0
20 22 1 0
22 16 1 0
18 23 1 0
16 18 1 0
17 23 1 0
12 13 2 0
13 19 1 0
24 17 1 0
21 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 2 0
29 33 1 0
33 34 3 0
34 8 1 0
36 35 1 0
16 35 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
23 42 1 1
39 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.82Molecular Weight (Monoisotopic): 602.3621AlogP: 6.75#Rotatable Bonds: 8Polar Surface Area: 57.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.48CX LogP: 6.56CX LogD: 6.22Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.29Np Likeness Score: -1.10
References 1. Nagao S, Yamane Y, Funasaka S, Tanaka K, Miyazaki K, Kotake Y, Kamata J, Watanabe-Miyano S, Toyama O, Ozawa Y, Mizui Y, Okamoto K, Ito D.. (2014) Synthesis and structure-activity relationships of novel, potent, orally active hypoxia-inducible factor-1 inhibitors., 22 (19): [PMID:25139751 ] [10.1016/j.bmc.2014.07.020 ]