2-(2,6-dimethylphenyl)-3-hydroxy-5-((5,6,7,8-tetrahydronaphthalen-1-yl)methyl)cyclopent-2-enone

ID: ALA3335481

PubChem CID: 118714500

Max Phase: Preclinical

Molecular Formula: C24H26O2

Molecular Weight: 346.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C)c1C1=C(O)CC(Cc2cccc3c2CCCC3)C1=O

Standard InChI:  InChI=1S/C24H26O2/c1-15-7-5-8-16(2)22(15)23-21(25)14-19(24(23)26)13-18-11-6-10-17-9-3-4-12-20(17)18/h5-8,10-11,19,25H,3-4,9,12-14H2,1-2H3

Standard InChI Key:  RSHNCVXKIMUWTH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   10.7257   -0.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1346   -0.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1323   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4275    0.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8427   -1.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8436   -2.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1839   -2.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4372   -3.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2544   -3.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5061   -2.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2831   -2.4098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9575   -4.1026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7355   -4.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4019   -4.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8822   -5.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6957   -5.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0266   -4.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5443   -4.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5891   -4.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8725   -3.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4283   -1.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7249   -0.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0275   -1.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0274   -2.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7309   -2.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4344   -2.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 22  2  0
 21  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
 10 11  2  0
  8 12  1  0
  9 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 14 19  1  0
 18 20  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3335481

    ---

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.47Molecular Weight (Monoisotopic): 346.1933AlogP: 5.28#Rotatable Bonds: 3
Polar Surface Area: 37.30Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.95CX Basic pKa: CX LogP: 6.48CX LogD: 6.47
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.82Np Likeness Score: 0.52

References

1. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C..  (2014)  Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists.,  (9): [PMID:25221659] [10.1021/ml5002085]

Source