(+/-)-4-Chloro-N-(3-((4-hydroxy-2-oxo-3-phenylcyclopent-3-enyl)methyl)phenethyl)benzene sulfonamide

ID: ALA3335482

PubChem CID: 71138563

Max Phase: Preclinical

Molecular Formula: C26H24ClNO4S

Molecular Weight: 482.00

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C(c2ccccc2)=C(O)CC1Cc1cccc(CCNS(=O)(=O)c2ccc(Cl)cc2)c1

Standard InChI:  InChI=1S/C26H24ClNO4S/c27-22-9-11-23(12-10-22)33(31,32)28-14-13-18-5-4-6-19(15-18)16-21-17-24(29)25(26(21)30)20-7-2-1-3-8-20/h1-12,15,21,28-29H,13-14,16-17H2

Standard InChI Key:  JHOUUOCFBJPMGV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   10.1819   -9.7526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7774   -9.0469    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.3684   -9.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1930   -9.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8983   -8.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6036   -9.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6020   -9.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3062  -10.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0125   -9.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0102   -9.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3054   -8.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4841   -8.6362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0687   -8.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0703   -7.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3622   -7.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6547   -7.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6598   -8.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3684   -9.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9453   -7.4229    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.3093  -11.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0186  -11.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1079  -12.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9079  -12.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3138  -11.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7646  -11.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9303  -10.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2432  -13.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1262  -11.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6055  -12.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4172  -12.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7474  -11.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2598  -10.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4499  -10.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  4 12  1  0
 12  2  1  0
  2 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
  8 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 25 26  2  0
 23 27  1  0
 24 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.00Molecular Weight (Monoisotopic): 481.1115AlogP: 4.96#Rotatable Bonds: 8
Polar Surface Area: 83.47Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.68CX Basic pKa: CX LogP: 5.45CX LogD: 5.43
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.43

References

1. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C..  (2014)  Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists.,  (9): [PMID:25221659] [10.1021/ml5002085]
2. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C..  (2014)  Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists.,  (9): [PMID:25221659] [10.1021/ml5002085]

Source