Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

(4-(3-chloro-4-methoxybenzylamino)-2-(2-methoxyethoxy)pyrimidin-5-yl)(3,4,5-trimethoxyphenyl)methanone

ID: ALA3338450

PubChem CID: 118715292

Max Phase: Preclinical

Molecular Formula: C25H28ClN3O7

Molecular Weight: 517.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOc1ncc(C(=O)c2cc(OC)c(OC)c(OC)c2)c(NCc2ccc(OC)c(Cl)c2)n1

Standard InChI:  InChI=1S/C25H28ClN3O7/c1-31-8-9-36-25-28-14-17(22(30)16-11-20(33-3)23(35-5)21(12-16)34-4)24(29-25)27-13-15-6-7-19(32-2)18(26)10-15/h6-7,10-12,14H,8-9,13H2,1-5H3,(H,27,28,29)

Standard InChI Key:  DWOHZVWMZVJTJI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    2.9289  -13.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9278  -13.9028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6358  -14.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6340  -12.6744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426  -13.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3434  -13.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0519  -14.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7602  -13.8949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0464  -12.6694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0527  -15.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3442  -15.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3455  -16.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0546  -16.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7638  -16.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7590  -15.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2211  -12.6749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5135  -13.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8057  -12.6752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4738  -16.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4784  -17.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0574  -17.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3511  -17.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6385  -16.7553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9301  -16.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0429  -11.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7489  -11.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4616  -11.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1671  -11.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1641  -10.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4497  -10.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7472  -10.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8763  -11.8461    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.8696  -10.2096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5795  -10.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0981  -13.0840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6119  -12.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
  1 16  1  0
 16 17  1  0
 17 18  1  0
 14 19  1  0
 19 20  1  0
 13 21  1  0
 21 22  1  0
 12 23  1  0
 23 24  1  0
  9 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 28 32  1  0
 29 33  1  0
 33 34  1  0
 18 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3338450

    ---

Associated Targets(non-human)

PDE5A Phosphodiesterase 5A (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Corpus cavernosum (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 517.97Molecular Weight (Monoisotopic): 517.1616AlogP: 4.03#Rotatable Bonds: 13
Polar Surface Area: 110.26Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.44CX LogP: 4.40CX LogD: 4.40
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.86

References

1. Sakamoto T, Koga Y, Hikota M, Matsuki K, Murakami M, Kikkawa K, Fujishige K, Kotera J, Omori K, Morimoto H, Yamada K..  (2014)  Design and synthesis of novel 5-(3,4,5-trimethoxybenzoyl)-4-aminopyrimidine derivatives as potent and selective phosphodiesterase 5 inhibitors: scaffold hopping using a pseudo-ring by intramolecular hydrogen bond formation.,  24  (22): [PMID:25442307] [10.1016/j.bmcl.2014.09.082]

Source