The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{(4-[5-(5-methylthiophen-2-yl)-3-thiophen-2-yl-4,5-dihydro-pyrazol-1-yl]-phenyl)sulfonyl}N'-p-tolylurea ID: ALA3338705
PubChem CID: 118715481
Max Phase: Preclinical
Molecular Formula: C26H24N4O3S3
Molecular Weight: 536.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)NS(=O)(=O)c2ccc(N3N=C(c4cccs4)CC3c3ccc(C)s3)cc2)cc1
Standard InChI: InChI=1S/C26H24N4O3S3/c1-17-5-8-19(9-6-17)27-26(31)29-36(32,33)21-12-10-20(11-13-21)30-23(25-14-7-18(2)35-25)16-22(28-30)24-4-3-15-34-24/h3-15,23H,16H2,1-2H3,(H2,27,29,31)
Standard InChI Key: KPHFWRFVPLFQJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
32.4493 -17.5985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4493 -16.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1583 -16.3686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7402 -16.3686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7402 -15.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0311 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7402 -13.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4493 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0311 -14.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4493 -14.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7402 -13.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1583 -18.0071 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.5711 -17.2980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8716 -18.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7497 -18.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9284 -18.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5198 -19.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9284 -20.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7497 -20.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1583 -19.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5198 -20.8476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7053 -20.9358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5345 -21.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2436 -22.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8542 -21.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7872 -22.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0740 -21.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4676 -22.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7978 -22.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6165 -22.8710 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.6567 -21.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9911 -22.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8057 -22.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9764 -21.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2673 -21.2178 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.7237 -21.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 6 1 0
5 8 2 0
6 9 2 0
7 9 1 0
7 10 2 0
8 10 1 0
7 11 1 0
4 5 1 0
12 13 2 0
12 14 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
21 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
26 30 1 0
23 26 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
31 35 1 0
34 36 1 0
25 31 1 0
18 21 1 0
12 15 1 0
1 12 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.70Molecular Weight (Monoisotopic): 536.1011AlogP: 6.29#Rotatable Bonds: 6Polar Surface Area: 90.87Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.67CX Basic pKa: 2.71CX LogP: 6.62CX LogD: 5.96Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -2.10
References 1. Kharbanda C, Alam MS, Hamid H, Javed K, Shafi S, Ali Y, Alam P, Pasha MA, Dhulap A, Bano S, Nazreen S, Haider S.. (2014) Novel benzenesulfonylureas containing thiophenylpyrazoline moiety as potential antidiabetic and anticancer agents., 24 (22): [PMID:25442322 ] [10.1016/j.bmcl.2014.09.044 ]