(2E,4E)-5-{(2R,3S)-3-(tert-Butyl-dimethyl-silanyloxy)-4-[1-ethoxycarbonyl-meth-(E)-ylidene]-tetrahydro-pyran-2-yl}-penta-2,4-dienoic acid ethyl ester

ID: ALA333926

PubChem CID: 15934810

Max Phase: Preclinical

Molecular Formula: C22H36O6Si

Molecular Weight: 424.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C=C/C=C/[C@H]1OCC/C(=C\C(=O)OCC)[C@@H]1O[Si](C)(C)C(C)(C)C

Standard InChI:  InChI=1S/C22H36O6Si/c1-8-25-19(23)13-11-10-12-18-21(28-29(6,7)22(3,4)5)17(14-15-27-18)16-20(24)26-9-2/h10-13,16,18,21H,8-9,14-15H2,1-7H3/b12-10+,13-11+,17-16+/t18-,21+/m1/s1

Standard InChI Key:  CYQYRSXYLYHUPG-PAURMVCLSA-N

Molfile:  

     RDKit          2D

 29 29  0  0  1  0  0  0  0  0999 V2000
    1.5167   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042   -3.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -3.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0542   -4.1042    0.0000 Si  0  0  0  0  0  4  0  0  0  0  0  0
    0.0875   -5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -2.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8667   -3.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -0.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042   -2.3375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917   -1.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4667   -1.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0625   -2.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -2.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875   -6.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5167   -0.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208   -4.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875   -2.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -0.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -3.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3792   -4.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6667   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1792   -3.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4542   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3375   -5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417    0.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0500   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  2  2  0
  5  3  1  0
  6  4  1  0
  7  1  1  0
  8  5  1  0
  9 11  1  0
 10  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  7 14  1  6
 15  6  2  0
 16  9  2  0
 17  2  1  0
 18  6  1  0
 19 10  1  0
 20  9  1  0
 21  5  1  0
 22  5  1  0
 23  8  1  0
 24  8  1  0
 25  8  1  0
 26 20  1  0
 27 18  1  0
 28 26  1  0
 29 27  1  0
 19 17  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA333926

   ethyl (2E,4E)-5-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]penta-2,4-dienoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 424.61

Molecular Weight (Monoisotopic): 424.2281

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Bessodes M, Shamsazar J, Antonakis K, Lafarge-Frayssinet C, Frayssinet C.  (1991)  Studies on the macrocyclic part of the trichothecene satratoxin: partial synthesis and structure-activity relationship,  1  (7): [10.1016/S0960-894X(01)80473-X]

Source

Source(1):

• Scientific Literature