The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2alpha,3alpha-dihydroxyurs-12,20(30)-dien-28-oic acid ID: ALA3342057
PubChem CID: 118716213
Max Phase: Preclinical
Molecular Formula: C30H46O4
Molecular Weight: 470.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@H]1C
Standard InChI: InChI=1S/C30H46O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,18,20-24,31-32H,1,9-16H2,2-7H3,(H,33,34)/t18-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1
Standard InChI Key: PYUUJQUMSQBUIN-YKEAIUOESA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
16.2819 -18.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4064 -23.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0020 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5930 -23.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3004 -21.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3004 -22.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0056 -20.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7109 -21.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7120 -22.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4163 -22.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1241 -22.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4142 -20.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1226 -21.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1305 -19.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4150 -20.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8389 -20.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8288 -20.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5310 -21.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2478 -21.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2603 -20.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9780 -19.7858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9929 -18.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5552 -19.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5599 -18.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5914 -20.9808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5932 -22.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7036 -20.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7077 -23.0176 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4094 -21.7918 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.1151 -20.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8209 -21.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5473 -20.5825 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.9629 -20.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9634 -21.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6704 -20.1817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8564 -18.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2943 -17.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 6 1 0
5 7 1 0
6 3 1 0
3 9 1 0
8 7 1 0
8 9 1 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 15 1 0
13 17 1 0
16 14 2 0
14 15 1 0
16 17 1 0
16 23 1 0
17 18 1 0
18 19 1 0
19 20 1 0
23 20 1 0
20 21 1 0
21 22 1 0
22 1 1 0
1 24 1 0
23 24 1 0
5 25 1 6
6 26 1 6
8 27 1 1
9 28 1 6
12 29 1 6
13 30 1 1
17 31 1 6
23 32 1 1
20 33 1 1
33 34 2 0
33 35 1 0
24 36 1 1
1 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.69Molecular Weight (Monoisotopic): 470.3396AlogP: 5.98#Rotatable Bonds: 1Polar Surface Area: 77.76Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.72CX Basic pKa: ┄CX LogP: 5.16CX LogD: 2.53Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: 3.48
References 1. Li MM, Su XQ, Sun J, Gu YF, Huang Z, Zeng KW, Zhang Q, Zhao YF, Ferreira D, Zjawiony JK, Li J, Tu PF.. (2014) Anti-inflammatory ursane- and oleanane-type triterpenoids from Vitex negundo var. cannabifolia., 77 (10): [PMID:25245917 ] [10.1021/np500509q ] 2. Cai YH, Guo Y, Li Z, Wu D, Li X, Zhang H, Yang J, Lu H, Sun Z, Luo HB, Yin S, Wu Y.. (2016) Discovery and modelling studies of natural ingredients from Gaultheria yunnanensis (FRANCH.) against phosphodiesterase-4., 114 [PMID:26978121 ] [10.1016/j.ejmech.2015.12.002 ]