The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(((trans)-4-(((4-(Cyclopropylamino)-6-(pyridin-2-yl)pyrimidin-2-yl)amino)methyl)cyclohexyl)methyl)-3-fluorobenzenesulfonamide ID: ALA3342357
PubChem CID: 118716400
Max Phase: Preclinical
Molecular Formula: C26H31FN6O2S
Molecular Weight: 510.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NC[C@H]1CC[C@H](CNc2nc(NC3CC3)cc(-c3ccccn3)n2)CC1)c1cccc(F)c1
Standard InChI: InChI=1S/C26H31FN6O2S/c27-20-4-3-5-22(14-20)36(34,35)30-17-19-9-7-18(8-10-19)16-29-26-32-24(23-6-1-2-13-28-23)15-25(33-26)31-21-11-12-21/h1-6,13-15,18-19,21,30H,7-12,16-17H2,(H2,29,31,32,33)/t18-,19-
Standard InChI Key: ZQADOUAKKPQHRM-WGSAOQKQSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
4.3212 -8.7497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 -8.0440 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5078 -8.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5861 -3.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5850 -3.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2930 -4.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0027 -3.9805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9999 -3.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2912 -2.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2947 -5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5853 -5.6128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5847 -6.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2929 -6.8388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0030 -6.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0001 -5.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7121 -6.8322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4184 -6.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8767 -6.8373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1693 -6.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4613 -6.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7551 -6.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0492 -6.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0444 -7.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7517 -8.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4637 -7.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3349 -8.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6290 -7.6422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2136 -7.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2227 -6.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5177 -6.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8071 -6.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8061 -7.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5117 -8.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0979 -8.0412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2315 -6.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8206 -5.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
6 10 1 0
14 16 1 0
16 17 1 0
12 18 1 0
18 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 1
26 27 1 0
27 2 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
35 17 1 0
36 35 1 0
17 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.64Molecular Weight (Monoisotopic): 510.2213AlogP: 4.45#Rotatable Bonds: 10Polar Surface Area: 108.90Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.36CX Basic pKa: 5.40CX LogP: 4.44CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.69
References 1. Peukert S, Hughes R, Nunez J, He G, Yan Z, Jain R, Llamas L, Luchansky S, Carlson A, Liang G, Kunjathoor V, Pietropaolo M, Shapiro J, Castellana A, Wu X, Bose A.. (2014) Discovery of 2-Pyridylpyrimidines as the First Orally Bioavailable GPR39 Agonists., 5 (10): [PMID:25313322 ] [10.1021/ml500240d ]