The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{[4-(2-Methoxyphenyl)piperazin-1-yl]methyl}-8-(4-methylbenzenesulfonyl)-1,4-dioxa-8-azaspiro[4.5]decane ID: ALA3342867
PubChem CID: 118716714
Max Phase: Preclinical
Molecular Formula: C26H35N3O5S
Molecular Weight: 501.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CC2COC3(CCN(S(=O)(=O)c4ccc(C)cc4)CC3)O2)CC1
Standard InChI: InChI=1S/C26H35N3O5S/c1-21-7-9-23(10-8-21)35(30,31)29-13-11-26(12-14-29)33-20-22(34-26)19-27-15-17-28(18-16-27)24-5-3-4-6-25(24)32-2/h3-10,22H,11-20H2,1-2H3
Standard InChI Key: VQLNHQYXLDPOCF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.1656 -18.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5783 -18.9275 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9867 -18.2151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6711 -20.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8610 -21.0089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6785 -21.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9954 -20.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3712 -19.7855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2760 -19.3534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2548 -20.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9534 -20.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6944 -19.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9959 -18.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1091 -21.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9302 -21.7540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3524 -22.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1700 -22.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5684 -21.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1390 -21.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3152 -21.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3864 -21.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8097 -22.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6300 -22.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0281 -21.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5957 -20.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7768 -20.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3510 -20.2771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7422 -19.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8610 -19.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1676 -18.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4507 -19.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4305 -20.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1330 -20.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8471 -20.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7136 -20.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 1 0
9 13 1 0
10 11 1 0
11 4 1 0
4 12 1 0
12 13 1 0
6 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
26 27 1 0
27 28 1 0
9 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.65Molecular Weight (Monoisotopic): 501.2297AlogP: 2.72#Rotatable Bonds: 6Polar Surface Area: 71.55Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.32CX LogP: 3.86CX LogD: 3.60Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -1.26
References 1. Franchini S, Battisti UM, Baraldi A, Prandi A, Fossa P, Cichero E, Tait A, Sorbi C, Marucci G, Cilia A, Pirona L, Brasili L.. (2014) Structure-affinity/activity relationships of 1,4-dioxa-spiro[4.5]decane based ligands at α1 and 5-HT1A receptors., 87 [PMID:25261823 ] [10.1016/j.ejmech.2014.09.070 ]