The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(6-Hydroxy-3-(4-hydroxyphenyl)benzo[b]selenophene-2-carbonyl)phenoxy)-N,N-dimethylethylamine hydrochloride ID: ALA3343820
PubChem CID: 118717369
Max Phase: Preclinical
Molecular Formula: C25H24ClNO4Se
Molecular Weight: 480.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCOc1ccc(C(=O)c2[se]c3cc(O)ccc3c2-c2ccc(O)cc2)cc1.Cl
Standard InChI: InChI=1S/C25H23NO4Se.ClH/c1-26(2)13-14-30-20-10-5-17(6-11-20)24(29)25-23(16-3-7-18(27)8-4-16)21-12-9-19(28)15-22(21)31-25;/h3-12,15,27-28H,13-14H2,1-2H3;1H
Standard InChI Key: ALZCMKWBMQKXKY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
14.4478 -24.2139 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2885 -24.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2873 -25.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9954 -26.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9936 -24.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7022 -24.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7025 -25.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4854 -25.9196 0.0000 Se 0 0 0 0 0 2 0 0 0 0 0 0
8.9691 -25.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4850 -24.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5793 -26.0735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7373 -23.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7863 -25.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1952 -25.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1947 -24.5453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5377 -23.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7901 -22.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2428 -22.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4400 -22.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1913 -23.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7834 -26.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1915 -27.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0096 -27.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4178 -26.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0073 -25.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4941 -21.4807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4194 -28.0815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2366 -28.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6463 -28.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4635 -28.7858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8733 -29.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8709 -28.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
3 11 1 0
10 12 1 0
9 13 1 0
13 14 1 0
13 15 2 0
12 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 12 1 0
14 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 14 1 0
18 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.42Molecular Weight (Monoisotopic): 481.0792AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Arsenyan P, Paegle E, Domracheva I, Gulbe A, Kanepe-Lapsa I, Shestakova I.. (2014) Selenium analogues of raloxifene as promising antiproliferative agents in treatment of breast cancer., 87 [PMID:25282270 ] [10.1016/j.ejmech.2014.09.088 ]