(3S,6S,9S)-14-amino-3,6-bis(4-aminobutyl)-14-imino-1,4,7-trioxo-1-phenyl-2,5,8,13-tetraazatetradecane-9-carboxylic acid

ID: ALA3344313

PubChem CID: 25147578

Max Phase: Preclinical

Molecular Formula: C25H42N8O5

Molecular Weight: 534.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)c1ccccc1)C(=O)O

Standard InChI:  InChI=1S/C25H42N8O5/c26-14-6-4-11-18(31-21(34)17-9-2-1-3-10-17)22(35)32-19(12-5-7-15-27)23(36)33-20(24(37)38)13-8-16-30-25(28)29/h1-3,9-10,18-20H,4-8,11-16,26-27H2,(H,31,34)(H,32,35)(H,33,36)(H,37,38)(H4,28,29,30)/t18-,19-,20-/m0/s1

Standard InChI Key:  ATHBVUKBXSKAHW-UFYCRDLUSA-N

Molfile:  

     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
    5.6987   -8.0976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4064   -7.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1141   -8.9148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1141   -8.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4064   -6.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1141   -6.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1141   -5.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8218   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8218   -4.4203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8218   -7.6890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5295   -8.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2372   -6.8718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2372   -7.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5295   -8.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2372   -9.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2372  -10.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9449  -10.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9449  -11.3664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0680   -5.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0680   -4.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3603   -4.0117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7757   -4.0117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9449   -8.0976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6526   -7.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3603   -8.9148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3603   -8.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6526   -6.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3603   -6.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3603   -5.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0680   -7.6890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8422   -8.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8411   -8.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5574   -9.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2712   -8.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2684   -8.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5556   -7.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9800   -7.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9715   -6.8691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4 10  1  0
 13 23  1  0
 26 30  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  1  0
 11 13  1  0
 13 12  2  0
 11 14  1  6
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 23 24  1  0
 24 26  1  0
 26 25  2  0
 24 27  1  1
 27 28  1  0
 28 29  1  0
 29 19  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 35 37  1  0
 37  1  1  0
 37 38  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.66Molecular Weight (Monoisotopic): 534.3278AlogP: -0.64#Rotatable Bonds: 19
Polar Surface Area: 238.54Molecular Species: ZWITTERIONHBA: 7HBD: 9
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 12#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.74CX Basic pKa: 11.92CX LogP: -2.97CX LogD: -8.00
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.06Np Likeness Score: 0.13

References

1. Bhakat S, Karubiu W, Jayaprakash V, Soliman ME..  (2014)  A perspective on targeting non-structural proteins to combat neglected tropical diseases: Dengue, West Nile and Chikungunya viruses.,  87  [PMID:25305334] [10.1016/j.ejmech.2014.10.010]

Source