7-((3-(benzyloxy)phenyl)(thiazol-2-ylamino)methyl)quinolin-8-ol

ID: ALA3344316

PubChem CID: 45256024

Max Phase: Preclinical

Molecular Formula: C26H21N3O2S

Molecular Weight: 439.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(C(Nc2nccs2)c2cccc(OCc3ccccc3)c2)ccc2cccnc12

Standard InChI:  InChI=1S/C26H21N3O2S/c30-25-22(12-11-19-9-5-13-27-24(19)25)23(29-26-28-14-15-32-26)20-8-4-10-21(16-20)31-17-18-6-2-1-3-7-18/h1-16,23,30H,17H2,(H,28,29)

Standard InChI Key:  PUCQVHMFWNUMDU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   18.6578   -5.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6566   -6.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3647   -6.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3629   -4.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0715   -5.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0723   -6.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7808   -6.5177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4891   -6.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4843   -5.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7752   -4.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3666   -7.3409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9486   -6.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2412   -6.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9480   -7.3400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2399   -7.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2464   -5.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5399   -4.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8308   -5.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8328   -6.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5400   -6.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5409   -4.0703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2491   -3.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2502   -2.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4937   -7.4165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9464   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3544   -8.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1538   -8.5620    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.9604   -2.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9618   -1.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2541   -1.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5435   -1.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5456   -2.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
  2 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 15 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 15  1  0
 23 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 23  1  0
M  END

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.54Molecular Weight (Monoisotopic): 439.1354AlogP: 6.18#Rotatable Bonds: 7
Polar Surface Area: 67.27Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: 4.56CX LogP: 5.72CX LogD: 5.69
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -1.19

References

1. Bhakat S, Karubiu W, Jayaprakash V, Soliman ME..  (2014)  A perspective on targeting non-structural proteins to combat neglected tropical diseases: Dengue, West Nile and Chikungunya viruses.,  87  [PMID:25305334] [10.1016/j.ejmech.2014.10.010]

Source