N-(4-ethylphenyl)-2-(6-(2-(4-methyl-5-phenyl-4H-1,2,4-triazol-3-ylthio)acetamido)benzo[d]thiazol-2-ylthio)acetamide

ID: ALA3344317

PubChem CID: 71663125

Max Phase: Preclinical

Molecular Formula: C28H26N6O2S3

Molecular Weight: 574.76

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1ccc(NC(=O)CSc2nc3ccc(NC(=O)CSc4nnc(-c5ccccc5)n4C)cc3s2)cc1

Standard InChI:  InChI=1S/C28H26N6O2S3/c1-3-18-9-11-20(12-10-18)29-25(36)17-38-28-31-22-14-13-21(15-23(22)39-28)30-24(35)16-37-27-33-32-26(34(27)2)19-7-5-4-6-8-19/h4-15H,3,16-17H2,1-2H3,(H,29,36)(H,30,35)

Standard InChI Key:  GKVWJXCPRPFPSF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   16.5488   -8.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5476   -8.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2557   -9.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2539   -7.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9625   -8.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9673   -8.8920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7473   -9.1404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2247   -8.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7396   -7.8159    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.8410   -7.6685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1334   -8.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4255   -7.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1335   -8.8945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7179   -8.0776    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.0101   -7.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0419   -8.4705    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.4546   -9.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2718   -9.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6846   -9.8762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6762   -8.4608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2801  -10.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4619  -10.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0575  -11.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4703  -12.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2917  -11.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6924  -11.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0669  -12.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2497  -12.7203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9238   -6.8579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244   -6.6881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7159   -7.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2630   -8.0031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9055   -7.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4254   -6.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6135   -6.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2806   -7.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7657   -8.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5760   -8.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0937   -8.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
  8 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 15 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 15  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 31 33  1  0
 32 39  1  0
M  END

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.76Molecular Weight (Monoisotopic): 574.1279AlogP: 6.12#Rotatable Bonds: 10
Polar Surface Area: 101.80Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.18CX Basic pKa: 1.56CX LogP: 6.07CX LogD: 6.07
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: -2.29

References

1. Bhakat S, Karubiu W, Jayaprakash V, Soliman ME..  (2014)  A perspective on targeting non-structural proteins to combat neglected tropical diseases: Dengue, West Nile and Chikungunya viruses.,  87  [PMID:25305334] [10.1016/j.ejmech.2014.10.010]

Source