3-(benzylthio)-6-(4-chlorophenyl)-10-methyl-1-oxo-1,4,6,7-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium

ID: ALA3344318

PubChem CID: 136044224

Max Phase: Preclinical

Molecular Formula: C24H20ClN4OS+

Molecular Weight: 447.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(c1)-c1c(=O)nc(SCc3ccccc3)[nH][n+]1C(c1ccc(Cl)cc1)N2

Standard InChI:  InChI=1S/C24H19ClN4OS/c1-15-7-12-20-19(13-15)21-23(30)27-24(31-14-16-5-3-2-4-6-16)28-29(21)22(26-20)17-8-10-18(25)11-9-17/h2-13,22H,14H2,1H3,(H,27,28,30)/p+1

Standard InChI Key:  YRPSPYXUDFERHU-UHFFFAOYSA-O

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   14.4150   -6.0670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4138   -6.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1201   -5.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8251   -6.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5279   -5.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5270   -4.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8174   -4.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1175   -4.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8316   -6.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1211   -7.2933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1195   -8.1104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8277   -8.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5389   -8.1089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5370   -7.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7088   -7.2955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0008   -6.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2936   -7.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2932   -8.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0060   -8.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7102   -8.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8276   -9.3383    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.5353   -9.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5352  -10.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8267  -10.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8262  -11.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5344  -12.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2445  -11.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2415  -10.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2335   -4.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5861   -8.5209    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.2442   -6.8837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 10  1  0
  9  4  1  0
  3  1  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  3  2  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  2 15  1  0
 12 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  6 29  1  0
 18 30  1  0
 14 31  2  0
M  CHG  1  10   1
M  END

Alternative Forms

  1. Parent:

    ALA3344318

    ---

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.97Molecular Weight (Monoisotopic): 447.1041AlogP: 4.95#Rotatable Bonds: 4
Polar Surface Area: 61.66Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 0.58CX Basic pKa: CX LogP: 4.45CX LogD: 5.12
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.34Np Likeness Score: -0.93

References

1. Bhakat S, Karubiu W, Jayaprakash V, Soliman ME..  (2014)  A perspective on targeting non-structural proteins to combat neglected tropical diseases: Dengue, West Nile and Chikungunya viruses.,  87  [PMID:25305334] [10.1016/j.ejmech.2014.10.010]

Source