The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-6-amino-N-((S)-6-amino-1-(((trans)-4-guanidinocyclohexyl)methylamino)-1-oxohexan-2-yl)-2-(2-(3,4-dichlorophenyl)acetamido)hexanamide ID: ALA3344321
PubChem CID: 71296029
Max Phase: Preclinical
Molecular Formula: C28H46Cl2N8O3
Molecular Weight: 613.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)N[C@H]1CC[C@H](CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)Cc2ccc(Cl)c(Cl)c2)CC1
Standard InChI: InChI=1S/C28H46Cl2N8O3/c29-21-12-9-19(15-22(21)30)16-25(39)37-24(6-2-4-14-32)27(41)38-23(5-1-3-13-31)26(40)35-17-18-7-10-20(11-8-18)36-28(33)34/h9,12,15,18,20,23-24H,1-8,10-11,13-14,16-17,31-32H2,(H,35,40)(H,37,39)(H,38,41)(H4,33,34,36)/t18-,20-,23-,24-/m0/s1
Standard InChI Key: OWKCLMWSCHVRNJ-BTDFZRAWSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
10.3080 -3.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3327 -4.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0570 -4.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7566 -4.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7283 -3.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0040 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5838 -3.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8842 -3.6727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4809 -4.7886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1769 -4.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9012 -4.7408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1502 -3.5367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6326 -3.8533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3240 -3.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0858 -4.6124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0524 -3.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2906 -2.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9820 -2.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9473 -1.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6387 -0.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6053 -0.0790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7438 -3.3528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4686 -3.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1266 -2.4739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1600 -3.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5055 -4.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2304 -4.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2673 -5.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9900 -6.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0269 -6.9448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0923 -2.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0912 -3.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7992 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5089 -3.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5060 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -2.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3831 -3.8566 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.3845 -2.2206 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2172 -3.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9243 -3.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9230 -2.6287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 1 0
1 7 1 6
9 10 1 0
10 11 2 0
10 12 1 0
4 9 1 1
16 22 1 0
13 14 1 0
14 16 1 0
16 15 2 0
14 17 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 1 0
23 25 1 0
25 24 2 0
23 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
32 37 1 0
31 38 1 0
34 39 1 0
39 40 1 0
40 13 1 0
40 41 2 0
25 8 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 613.64Molecular Weight (Monoisotopic): 612.3070AlogP: 1.92#Rotatable Bonds: 17Polar Surface Area: 201.24Molecular Species: BASEHBA: 6HBD: 8#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.09CX Basic pKa: 11.84CX LogP: 0.75CX LogD: -6.43Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.07Np Likeness Score: -0.39
References 1. Bhakat S, Karubiu W, Jayaprakash V, Soliman ME.. (2014) A perspective on targeting non-structural proteins to combat neglected tropical diseases: Dengue, West Nile and Chikungunya viruses., 87 [PMID:25305334 ] [10.1016/j.ejmech.2014.10.010 ] 2. Voss S, Nitsche C.. (2021) Targeting the protease of West Nile virus., 12 (8.0): [PMID:34458734 ] [10.1039/D1MD00080B ]