N-(4-{4-[2-(3,5-dimethoxy-phenyl)-vinyl]-indol-1yl}-butyl)-4-methyl-benzenesulfonamide

ID: ALA3344401

PubChem CID: 118717760

Max Phase: Preclinical

Molecular Formula: C29H32N2O4S

Molecular Weight: 504.65

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/c2cccc3c2ccn3CCCCNS(=O)(=O)c2ccc(C)cc2)cc(OC)c1

Standard InChI:  InChI=1S/C29H32N2O4S/c1-22-9-13-27(14-10-22)36(32,33)30-16-4-5-17-31-18-15-28-24(7-6-8-29(28)31)12-11-23-19-25(34-2)21-26(20-23)35-3/h6-15,18-21,30H,4-5,16-17H2,1-3H3/b12-11+

Standard InChI Key:  MKSOLNWGSYDLBC-VAWYXSNFSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   26.7857  -10.8092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0003  -11.6016    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.5793  -11.0196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6541  -14.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6530  -15.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3611  -15.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3593  -14.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0679  -14.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0681  -15.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8468  -15.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3278  -15.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8464  -14.4444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3632  -16.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6566  -17.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6588  -17.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9507  -18.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9525  -19.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6619  -19.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3708  -19.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3655  -18.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0986  -13.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8979  -13.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1502  -12.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9494  -12.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2457  -19.6103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5371  -19.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0811  -19.5970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0861  -20.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2017  -11.7722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5480  -12.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2942  -12.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8405  -13.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6407  -13.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8918  -12.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3438  -12.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1885  -14.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  6 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 12 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 17 25  1  0
 25 26  1  0
 19 27  1  0
 27 28  1  0
 24 29  1  0
 29  2  1  0
  2 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3344401

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 504.65

Molecular Weight (Monoisotopic): 504.2083

AlogP: 5.90

#Rotatable Bonds: 11

Polar Surface Area: 69.56

Molecular Species: NEUTRAL

HBA: 5

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 10.40

CX Basic pKa: ┄

CX LogP: 6.04

CX LogD: 6.04

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.20

Np Likeness Score: -1.12

References

1. Ferla S, Gomaa MS, Brancale A, Zhu J, Ochalek JT, DeLuca HF, Simons C..  (2014)  Novel styryl-indoles as small molecule inhibitors of 25-hydroxyvitamin D-24-hydroxylase (CYP24A1): Synthesis and biological evaluation.,  87  [PMID:25240094] [10.1016/j.ejmech.2014.09.035]

2. Bruno, Robert D RD and Njar, Vincent C O VC.  2007-08-01  Targeting cytochrome P450 enzymes: a new approach in anti-cancer drug development.  [PMID:17544277]

3. Taban, Ismail M IM, Zhu, Jinge J, DeLuca, Hector F HF and Simons, Claire C.  2017-08-01  Synthesis, molecular modelling and CYP24A1 inhibitory activity of novel of (E)-N-(2-(1H-imidazol-1-yl)-2-(phenylethyl)-3/4-styrylbenzamides.  [PMID:28601511]

Source

Source(1):

• Scientific Literature