The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
gamma-rubromycin ID: ALA3347482
PubChem CID: 137321735
Max Phase: Preclinical
Molecular Formula: C26H18O12
Molecular Weight: 522.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc2cc3c(c(O)c2c(=O)o1)O[C@]1(CC3)Cc2c(O)c3c(c(O)c2O1)C(=O)C(OC)=CC3=O
Standard InChI: InChI=1S/C26H18O12/c1-34-13-7-12(27)16-17(19(13)29)21(31)23-11(18(16)28)8-26(38-23)4-3-9-5-10-6-14(24(32)35-2)36-25(33)15(10)20(30)22(9)37-26/h5-7,28,30-31H,3-4,8H2,1-2H3/t26-/m0/s1
Standard InChI Key: CKLKRRFSZZUFKT-SANMLTNESA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
6.9099 -10.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1353 -8.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9642 -8.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3457 -9.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1621 -9.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6030 -8.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2215 -8.0055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3989 -7.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0147 -7.2403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7477 -7.9076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4273 -8.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8095 -9.4988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8695 -8.0710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6938 -8.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0862 -10.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7030 -9.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8887 -9.3038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4515 -9.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8347 -10.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6552 -10.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3194 -9.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3182 -10.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0331 -10.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0313 -9.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0289 -8.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3965 -9.1757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3964 -8.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0329 -11.6533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7467 -9.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7456 -10.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4585 -10.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4609 -9.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4609 -8.3437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4563 -11.6509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1785 -9.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1793 -10.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9652 -10.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9639 -9.3304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 1 2 0
1 4 1 0
3 2 1 0
2 16 2 0
3 4 2 0
3 8 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
2 10 1 0
6 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 30 1 0
29 24 1 0
24 21 1 0
24 25 2 0
21 26 1 0
26 27 1 0
23 28 2 0
29 30 2 0
29 32 1 0
30 31 1 0
31 36 2 0
35 32 2 0
32 33 1 0
31 34 1 0
35 36 1 0
36 37 1 0
37 18 1 0
18 38 1 1
38 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.42Molecular Weight (Monoisotopic): 522.0798AlogP: 2.26#Rotatable Bonds: 2Polar Surface Area: 179.03Molecular Species: NEUTRALHBA: 12HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.59CX Basic pKa: ┄CX LogP: 4.33CX LogD: 4.30Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: 1.52
References 1. Chen JL, Sperry J, Ip NY, Brimble MA. (2011) Natural products targeting telomere maintenance, 2 (4): [10.1039/C0MD00241K ] 2. Wang X, Elshahawi SI, Ponomareva LV, Ye Q, Liu Y, Copley GC, Hower JC, Hatcher BE, Kharel MK, Van Lanen SG, She QB, Voss SR, Thorson JS, Shaaban KA.. (2019) Structure Determination, Functional Characterization, and Biosynthetic Implications of Nybomycin Metabolites from a Mining Reclamation Site-Associated Streptomyces ., 82 (12): [PMID:31833370 ] [10.1021/acs.jnatprod.9b01015 ]