4-(bis(2-methoxyethyl)amino)-7H-pyrido[4,3,2-de][1,7]phenanthrolin-7-one

ID: ALA3347687

PubChem CID: 10473946

Max Phase: Preclinical

Molecular Formula: C20H20N4O3

Molecular Weight: 364.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN(CCOC)c1cnc2c3c(nccc13)-c1cccnc1C2=O

Standard InChI:  InChI=1S/C20H20N4O3/c1-26-10-8-24(9-11-27-2)15-12-23-19-16-13(15)5-7-22-17(16)14-4-3-6-21-18(14)20(19)25/h3-7,12H,8-11H2,1-2H3

Standard InChI Key:  LTTYTBNHKUPCMG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    8.7710  -22.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7699  -23.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4845  -23.4418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4826  -21.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1979  -22.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1967  -23.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9094  -23.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6274  -23.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3396  -23.4368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0538  -23.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0515  -22.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9118  -21.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6280  -22.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3467  -21.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9136  -20.9577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9088  -24.2641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6293  -20.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3470  -20.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7651  -21.7841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4800  -22.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7639  -20.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4777  -20.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4765  -19.7212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1901  -19.3078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4812  -23.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1961  -23.4316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1973  -24.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 12  1  0
  6  7  1  0
  7  8  1  0
 13  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 12 13  1  0
 13 14  1  0
 14 18  1  0
 17 15  1  0
 15 12  2  0
  7 16  2  0
 17 18  2  0
 11 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

A-427 (643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.41Molecular Weight (Monoisotopic): 364.1535AlogP: 2.34#Rotatable Bonds: 7
Polar Surface Area: 77.44Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.54CX LogP: 1.61CX LogD: 1.61
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.50Np Likeness Score: -0.07

References

1. Chen JL, Sperry J, Ip NY, Brimble MA.  (2011)  Natural products targeting telomere maintenance,  (4): [10.1039/C0MD00241K]

Source