7-(3-Hexylsulfanylmethyl-7-oxa-bicyclo[2.2.1]hept-2-yl)-hept-5-enoic acid

ID: ALA3349042

PubChem CID: 118718127

Max Phase: Preclinical

Molecular Formula: C20H34O3S

Molecular Weight: 354.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCSC[C@H]1C2CC[C@@H](O2)[C@H]1C/C=C\CCCC(=O)O

Standard InChI:  InChI=1S/C20H34O3S/c1-2-3-4-9-14-24-15-17-16(18-12-13-19(17)23-18)10-7-5-6-8-11-20(21)22/h5,7,16-19H,2-4,6,8-15H2,1H3,(H,21,22)/b7-5-/t16-,17+,18+,19?/m0/s1

Standard InChI Key:  YHSIOGBAMKKEDO-CMKHJVDASA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   -5.3628   -1.7456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7074   -0.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4069   -0.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0855   -0.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2663    0.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5188    0.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1442   -0.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7661    0.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5124    0.9200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6971    0.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7015    0.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1781   -1.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3065   -0.4412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4786   -0.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1906   -1.8213    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7248   -0.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8444   -0.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5542   -2.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0567    0.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9240   -1.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0209   -2.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6573   -1.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2875   -2.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3907   -1.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  1  6
  5  4  1  0
  6 16  1  0
  7  3  1  0
  8  4  1  0
  9  6  2  0
 10 14  1  0
 11 10  2  0
  2 12  1  1
 13  6  1  0
  5 14  1  1
 15 12  1  0
 16 19  1  0
 17 11  1  0
 18 15  1  0
 19 17  1  0
 20 18  1  0
 21 22  1  0
 22 23  1  0
 23 20  1  0
 24 21  1  0
  7  8  1  0
  5  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3349042

    ---

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Homo sapiens (32628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cavia porcellus (23802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.56Molecular Weight (Monoisotopic): 354.2229AlogP: 5.29#Rotatable Bonds: 13
Polar Surface Area: 46.53Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.31CX Basic pKa: CX LogP: 5.12CX LogD: 2.16
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.36Np Likeness Score: 1.06

References

1. Hall SE, Han WC, Harris DN, Hedberg A, Ogletree ML..  (1989)  9,11-Epoxy-9-homo-14-thiaprost-5-enoic acid derivatives: potent thromboxane A2 antagonists.,  32  (5): [PMID:2523485] [10.1021/jm00125a009]
2. Hall SE, Han WC, Harris DN, Hedberg A, Ogletree ML..  (1989)  9,11-Epoxy-9-homo-14-thiaprost-5-enoic acid derivatives: potent thromboxane A2 antagonists.,  32  (5): [PMID:2523485] [10.1021/jm00125a009]
3. Hall SE, Han WC, Harris DN, Hedberg A, Ogletree ML..  (1989)  9,11-Epoxy-9-homo-14-thiaprost-5-enoic acid derivatives: potent thromboxane A2 antagonists.,  32  (5): [PMID:2523485] [10.1021/jm00125a009]
4. Hall SE, Han WC, Harris DN, Hedberg A, Ogletree ML..  (1989)  9,11-Epoxy-9-homo-14-thiaprost-5-enoic acid derivatives: potent thromboxane A2 antagonists.,  32  (5): [PMID:2523485] [10.1021/jm00125a009]
5. Hall SE, Han WC, Harris DN, Hedberg A, Ogletree ML..  (1989)  9,11-Epoxy-9-homo-14-thiaprost-5-enoic acid derivatives: potent thromboxane A2 antagonists.,  32  (5): [PMID:2523485] [10.1021/jm00125a009]

Source