The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17-(1-Hydroxy-1,5-dimethyl-hex-4-enyl)-4,4,8,10,14-pentamethyl-hexadecahydro-cyclopenta[a]phenanthrene-3,6,12-triol ID: ALA3349973
PubChem CID: 118718679
Max Phase: Preclinical
Molecular Formula: C30H52O4
Molecular Weight: 476.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCC[C@](C)(O)[C@H]1CC[C@]2(C)C1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3[C@@H](O)C[C@]12C
Standard InChI: InChI=1S/C30H52O4/c1-18(2)10-9-13-30(8,34)19-11-15-28(6)24(19)20(31)16-22-27(5)14-12-23(33)26(3,4)25(27)21(32)17-29(22,28)7/h10,19-25,31-34H,9,11-17H2,1-8H3/t19-,20+,21-,22+,23-,24?,25-,27+,28+,29+,30-/m0/s1
Standard InChI Key: SHCBCKBYTHZQGZ-CXZUFSPBSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
4.9192 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6327 -3.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4965 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2100 -3.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4965 -4.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6369 -2.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9234 -4.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7830 -4.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2100 -4.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9234 -2.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2100 -2.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4255 -2.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4005 -3.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7830 -3.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8969 -2.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4213 -1.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0695 -4.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0695 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1918 -0.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3657 -0.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9109 -2.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6244 -4.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4923 -2.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9234 -1.2142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2100 -5.7496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6995 -0.9763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3671 -5.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1947 -5.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3561 -4.9318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9526 -0.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1265 -0.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4130 -0.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6049 -0.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6049 0.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2516 -2.2155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7820 -4.0979 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2100 -4.0962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 1 1 0
5 9 1 0
6 2 1 0
7 1 1 0
8 5 1 0
9 7 1 0
10 11 1 0
11 4 1 0
12 6 1 0
13 2 1 0
14 3 1 0
15 13 1 0
16 12 1 0
17 8 1 0
18 14 1 0
19 20 2 0
20 30 1 0
1 21 1 1
2 22 1 6
3 23 1 1
10 24 1 1
9 25 1 6
16 26 1 1
8 27 1 0
8 28 1 0
17 29 1 1
30 31 1 0
31 16 1 0
32 16 1 0
33 19 1 0
34 19 1 0
12 35 1 6
3 5 1 0
6 10 1 0
15 12 1 0
18 17 1 0
5 36 1 6
4 37 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.74Molecular Weight (Monoisotopic): 476.3866AlogP: 5.47#Rotatable Bonds: 4Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.22CX LogD: 4.22Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: 3.37
References 1. Kwon B, Lee S, Kim K, Lee I, Lee UC, Hong S, Bok S. (1997) Rhombenone: farnesyl protein transferase inhibitor from the leaves of Hedera rhombea Bean, 7 (8): [10.1016/S0960-894X(97)00139-X ]