17-(1-Hydroxy-1,5-dimethyl-hex-4-enyl)-4,4,8,10,14-pentamethyl-hexadecahydro-cyclopenta[a]phenanthrene-3,6,12-triol

ID: ALA3349973

PubChem CID: 118718679

Max Phase: Preclinical

Molecular Formula: C30H52O4

Molecular Weight: 476.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCC[C@](C)(O)[C@H]1CC[C@]2(C)C1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3[C@@H](O)C[C@]12C

Standard InChI:  InChI=1S/C30H52O4/c1-18(2)10-9-13-30(8,34)19-11-15-28(6)24(19)20(31)16-22-27(5)14-12-23(33)26(3,4)25(27)21(32)17-29(22,28)7/h10,19-25,31-34H,9,11-17H2,1-8H3/t19-,20+,21-,22+,23-,24?,25-,27+,28+,29+,30-/m0/s1

Standard InChI Key:  SHCBCKBYTHZQGZ-CXZUFSPBSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  1  0  0  0  0  0999 V2000
    4.9192   -3.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6327   -3.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4965   -3.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2100   -3.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4965   -4.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6369   -2.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9234   -4.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7830   -4.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2100   -4.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9234   -2.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2100   -2.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4255   -2.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4005   -3.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7830   -3.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8969   -2.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4213   -1.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0695   -4.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0695   -3.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1918   -0.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3657   -0.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9109   -2.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6244   -4.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4923   -2.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9234   -1.2142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2100   -5.7496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6995   -0.9763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3671   -5.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1947   -5.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3561   -4.9318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9526   -0.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1265   -0.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4130   -0.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6049   -0.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6049    0.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2516   -2.2155    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7820   -4.0979    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2100   -4.0962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  9  1  0
  6  2  1  0
  7  1  1  0
  8  5  1  0
  9  7  1  0
 10 11  1  0
 11  4  1  0
 12  6  1  0
 13  2  1  0
 14  3  1  0
 15 13  1  0
 16 12  1  0
 17  8  1  0
 18 14  1  0
 19 20  2  0
 20 30  1  0
  1 21  1  1
  2 22  1  6
  3 23  1  1
 10 24  1  1
  9 25  1  6
 16 26  1  1
  8 27  1  0
  8 28  1  0
 17 29  1  1
 30 31  1  0
 31 16  1  0
 32 16  1  0
 33 19  1  0
 34 19  1  0
 12 35  1  6
  3  5  1  0
  6 10  1  0
 15 12  1  0
 18 17  1  0
  5 36  1  6
  4 37  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3349973

    ---

Associated Targets(non-human)

Fdft1 Squalene synthetase (891 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.74Molecular Weight (Monoisotopic): 476.3866AlogP: 5.47#Rotatable Bonds: 4
Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.22CX LogD: 4.22
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: 3.37

References

1. Kwon B, Lee S, Kim K, Lee I, Lee UC, Hong S, Bok S.  (1997)  Rhombenone: farnesyl protein transferase inhibitor from the leaves of Hedera rhombea Bean,  (8): [10.1016/S0960-894X(97)00139-X]

Source