(3S,6S,8R,10R,12R,14R)-17-((R)-1-Hydroxy-1,5-dimethyl-hex-4-enyl)-4,4,8,10,14-pentamethyl-hexadecahydro-cyclopenta[a]phenanthrene-3,6,12-triol

ID: ALA3350010

PubChem CID: 118718705

Max Phase: Preclinical

Molecular Formula: C30H52O4

Molecular Weight: 476.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCC[C@@](C)(O)[C@H]1CC[C@]2(C)C1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3[C@@H](O)C[C@]12C

Standard InChI:  InChI=1S/C30H52O4/c1-18(2)10-9-13-30(8,34)19-11-15-28(6)24(19)20(31)16-22-27(5)14-12-23(33)26(3,4)25(27)21(32)17-29(22,28)7/h10,19-25,31-34H,9,11-17H2,1-8H3/t19-,20+,21-,22+,23-,24?,25-,27+,28+,29+,30+/m0/s1

Standard InChI Key:  SHCBCKBYTHZQGZ-QOOQWYQWSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  1  0  0  0  0  0999 V2000
    5.1139   -6.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8261   -6.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6895   -6.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4017   -6.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6934   -7.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8261   -5.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1178   -7.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9773   -7.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4017   -7.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1139   -4.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3939   -5.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6123   -4.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6084   -6.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9773   -6.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0910   -5.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6084   -4.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2690   -7.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2690   -6.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4611   -4.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7489   -3.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1061   -5.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8183   -6.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6817   -5.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1178   -3.9970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4017   -8.5271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8884   -3.7401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3935   -8.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3859   -8.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5528   -7.7098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0367   -4.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3128   -3.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6006   -3.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4689   -4.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1733   -3.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6914   -8.1222    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3976   -4.7249    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4017   -6.8768    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  9  1  0
  6  2  1  0
  7  1  1  0
  8  5  1  0
  9  7  1  0
 10 11  1  0
 11  4  1  0
 12  6  1  0
 13  2  1  0
 14  3  1  0
 15 13  1  0
 16 12  1  0
 17  8  1  0
 18 14  1  0
 19 20  2  0
 20 30  1  0
  1 21  1  1
  2 22  1  6
  3 23  1  1
 10 24  1  1
  9 25  1  6
 16 26  1  6
  8 27  1  0
  8 28  1  0
 17 29  1  1
 30 31  1  0
 31 16  1  0
 16 32  1  1
 33 19  1  0
 34 19  1  0
  3  5  1  0
  6 10  1  0
 15 12  1  0
 18 17  1  0
  5 35  1  6
 12 36  1  6
  4 37  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3350010

    ---

Associated Targets(non-human)

Soat1 Acyl coenzyme A:cholesterol acyltransferase 1 (2344 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.74Molecular Weight (Monoisotopic): 476.3866AlogP: 5.47#Rotatable Bonds: 4
Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.22CX LogD: 4.22
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: 3.37

References

1. Kwon BM, Kim MK, Baek NI, Kim DS, Park JD, Kim YK, Lee HK, Kim SI..  (1999)  Acyl-CoA: cholesterol acyltransferase inhibitory activity of ginseng sapogenins, produced from the ginseng saponins.,  (10): [PMID:10360739] [10.1016/s0960-894x(99)00208-5]

Source