1-(3-Benzoylsulfanyl-2-methyl-propionyl)-2,3-dihydro-1H-indole-2-carboxylic acid; compound with dicyclohexyl-amine

ID: ALA3350268

PubChem CID: 12764230

Max Phase: Preclinical

Molecular Formula: C32H42N2O4S

Molecular Weight: 369.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C1CCC(NC2CCCCC2)CC1.C[C@@H](CSC(=O)c1ccccc1)C(=O)N1c2ccccc2C[C@H]1C(=O)O

Standard InChI:  InChI=1S/C20H19NO4S.C12H23N/c1-13(12-26-20(25)14-7-3-2-4-8-14)18(22)21-16-10-6-5-9-15(16)11-17(21)19(23)24;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h2-10,13,17H,11-12H2,1H3,(H,23,24);11-13H,1-10H2/t13-,17-;/m0./s1

Standard InChI Key:  FDUNDKKQZVRPOM-KYLFUZKPSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -2.4277   -3.8454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7160   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1451   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8682   -3.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0101   -3.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7218   -2.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1451   -2.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2869   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9986   -2.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8568   -2.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5800   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5800   -2.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2869   -2.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7649    0.6657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0820    1.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7649   -0.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4594    1.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0934    1.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2555    1.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4709    1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9240   -0.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0762   -0.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6357   -0.5051    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4422   -0.5338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3589   -0.1033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8423    0.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9298    0.7346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2066   -0.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8537    1.7849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1424    0.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1481    2.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0590   -1.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2008   -1.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5051   -0.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8311    1.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8311    1.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2225   -0.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5223   -1.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2283   -1.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  2  1  0
  6  2  1  0
  7  3  1  0
  8  5  1  0
  9  6  1  0
 10  7  1  0
 11  4  1  0
 12 10  1  0
 13  9  1  0
 11 12  1  0
 13  8  1  0
 15 14  1  0
 16 14  1  0
 17 14  1  0
 18 15  1  0
 15 19  1  1
 20 17  2  0
 21 23  1  0
 22 16  1  0
 23 25  1  0
 24 16  2  0
 25 22  1  0
 26 19  2  0
 27 21  2  0
 28 21  1  0
 29 19  1  0
 30 17  1  0
 31 20  1  0
 22 32  1  6
 33 28  2  0
 34 28  1  0
 35 30  2  0
 36 31  2  0
 37 34  2  0
 38 33  1  0
 39 38  2  0
 18 20  1  0
 36 35  1  0
 37 39  1  0
M  END

Associated Targets(non-human)

Ace Angiotensin-converting enzyme (1080 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 369.44Molecular Weight (Monoisotopic): 369.1035AlogP: 3.24#Rotatable Bonds: 5
Polar Surface Area: 74.68Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.55CX Basic pKa: CX LogP: 3.91CX LogD: 0.56
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.88Np Likeness Score: -0.38

References

1. Kim DH, Guinosso CJ, Buzby GC, Herbst DR, McCaully RJ, Wicks TC, Wendt RL..  (1983)  (Mercaptopropanoyl)indoline-2-carboxylic acids and related compounds as potent angiotensin converting enzyme inhibitors and antihypertensive agents.,  26  (3): [PMID:6298429] [10.1021/jm00357a014]
2. Kim DH, Guinosso CJ, Buzby GC, Herbst DR, McCaully RJ, Wicks TC, Wendt RL..  (1983)  (Mercaptopropanoyl)indoline-2-carboxylic acids and related compounds as potent angiotensin converting enzyme inhibitors and antihypertensive agents.,  26  (3): [PMID:6298429] [10.1021/jm00357a014]

Source