2-(5-Carboxymethyl-4-oxo-2,3,4,5-tetrahydro-benzo[b][1,4]thiazepin-3-ylamino)-4-phenyl-butyric acid

ID: ALA3350310

PubChem CID: 13375127

Max Phase: Preclinical

Molecular Formula: C21H22N2O5S

Molecular Weight: 414.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CN1C(=O)[C@@H](N[C@H](CCc2ccccc2)C(=O)O)CSc2ccccc21

Standard InChI:  InChI=1S/C21H22N2O5S/c24-19(25)12-23-17-8-4-5-9-18(17)29-13-16(20(23)26)22-15(21(27)28)11-10-14-6-2-1-3-7-14/h1-9,15-16,22H,10-13H2,(H,24,25)(H,27,28)/t15-,16+/m1/s1

Standard InChI Key:  UWIKUJFVCXNPLG-CVEARBPZSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  1  0  0  0  0  0999 V2000
    4.8918   -4.6679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6960   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0484   -3.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2533   -4.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8775   -3.7476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8918   -2.8231    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.7052   -5.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1129   -3.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2879   -3.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2533   -3.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6960   -3.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3146   -6.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2059   -5.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5233   -3.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1281   -6.8402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8775   -2.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5233   -2.3174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0982   -5.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2879   -1.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8775   -0.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5362   -4.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5362   -2.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0608   -0.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2921   -0.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8231   -4.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8231   -3.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8817    0.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6380   -0.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0567    0.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  3  5  1  6
  6 10  1  0
  7  1  1  0
  8  9  1  0
  9  5  1  0
 10  4  1  0
 11  3  1  0
 12  7  1  0
 13  2  2  0
 14  8  2  0
 15 12  2  0
  9 16  1  6
 17  8  1  0
 18 12  1  0
 19 16  1  0
 20 19  1  0
 21  4  2  0
 22 10  2  0
 23 20  1  0
 24 20  2  0
 25 21  1  0
 26 25  2  0
 27 24  1  0
 28 23  2  0
 29 27  2  0
 11  6  1  0
 22 26  1  0
 28 29  1  0
M  END

Associated Targets(non-human)

Ace Angiotensin-converting enzyme (1080 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 414.48Molecular Weight (Monoisotopic): 414.1249AlogP: 2.25#Rotatable Bonds: 8
Polar Surface Area: 106.94Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 2.89CX Basic pKa: 7.59CX LogP: -0.07CX LogD: -3.32
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -0.39

References

1. Slade J, Stanton JL, Ben-David D, Mazzenga GC..  (1985)  Angiotensin converting enzyme inhibitors: 1,5-benzothiazepine derivatives.,  28  (10): [PMID:2995670] [10.1021/jm00148a024]

Source