The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-amino-N-{2-[(3-tert-butyl-4-hydroxyphenyl)methyl]-3,7,14-trioxo-1,4,8-triazacyclotetradecan-13-yl}-3-phenylpropanamide ID: ALA3350348
PubChem CID: 10940742
Max Phase: Preclinical
Molecular Formula: C31H43N5O5
Molecular Weight: 565.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(C[C@@H]2NC(=O)[C@@H](NC(=O)[C@H](N)Cc3ccccc3)CCCCNC(=O)CCNC2=O)ccc1O
Standard InChI: InChI=1S/C31H43N5O5/c1-31(2,3)22-17-21(12-13-26(22)37)19-25-29(40)34-16-14-27(38)33-15-8-7-11-24(30(41)36-25)35-28(39)23(32)18-20-9-5-4-6-10-20/h4-6,9-10,12-13,17,23-25,37H,7-8,11,14-16,18-19,32H2,1-3H3,(H,33,38)(H,34,40)(H,35,39)(H,36,41)/t23-,24+,25+/m1/s1
Standard InChI Key: RRXAKVUZGASTMY-DSITVLBTSA-N
Molfile:
RDKit 2D
41 43 0 0 1 0 0 0 0 0999 V2000
3.3790 -1.4849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3790 -0.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5224 -0.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6645 -1.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 -1.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8079 -0.6599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5211 -3.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 0.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0935 -0.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 -0.6599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2369 -0.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1933 -2.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 1.8151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5211 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 -2.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6645 -2.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6645 -0.2474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5224 0.5776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 0.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 -3.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 -1.8974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6645 0.5776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9514 -0.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 -4.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 -0.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2369 -1.4849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9501 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9514 0.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1933 -4.3724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6645 2.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9078 -2.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6058 -3.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2192 -2.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0935 0.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6658 0.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2369 0.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3790 1.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3790 0.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2369 1.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6658 1.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9514 2.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 1 1 0
5 4 1 0
9 6 1 6
7 15 1 0
8 19 1 0
9 2 1 0
10 5 1 0
11 3 1 0
12 7 1 0
13 8 1 0
14 24 1 0
15 20 2 0
4 16 1 1
17 2 2 0
18 3 2 0
19 25 1 0
20 16 1 0
21 5 2 0
22 8 2 0
11 23 1 1
24 27 2 0
25 10 1 0
26 11 1 0
27 20 1 0
28 23 1 0
29 14 1 0
30 37 1 0
31 12 1 0
32 12 1 0
33 12 1 0
34 9 1 0
35 28 1 0
36 28 2 0
37 38 1 0
38 34 1 0
39 36 1 0
40 35 2 0
41 39 2 0
14 7 2 0
13 30 1 0
41 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.72Molecular Weight (Monoisotopic): 565.3264AlogP: 1.58#Rotatable Bonds: 6Polar Surface Area: 162.65Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.10CX Basic pKa: 7.71CX LogP: 1.94CX LogD: 1.46Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: 0.55
References 1. Haramura M, Okamachi A, Tsuzuki K, Yogo K, Ikuta M, Kozono T, Takanashi H, Murayama E.. (2002) Design and synthesis of motilin antagonists derived from the [1-4] fragment of porcine motilin., 45 (3): [PMID:11806718 ] [10.1021/jm010332u ]