The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Daunomycin derivative ID: ALA3350772
PubChem CID: 118719124
Max Phase: Preclinical
Molecular Formula: C27H29NO13S
Molecular Weight: 607.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3O[C@H]1C[C@@H](N)[C@H](OS(=O)(=O)O)[C@H](C)O1
Standard InChI: InChI=1S/C27H29NO13S/c1-10-26(41-42(35,36)37)14(28)7-17(39-10)40-16-9-27(34,11(2)29)8-13-19(16)25(33)21-20(23(13)31)22(30)12-5-4-6-15(38-3)18(12)24(21)32/h4-6,10,14,16-17,26,31,33-34H,7-9,28H2,1-3H3,(H,35,36,37)/t10-,14+,16-,17-,26+,27-/m0/s1
Standard InChI Key: DLCSTDOMSIBIQJ-JBBADZSPSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
2.3728 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3728 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 -3.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8017 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8017 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3741 1.0018 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9439 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0873 -3.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0873 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9439 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6596 -0.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2307 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5162 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5162 -3.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2307 -1.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6596 -1.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2307 -0.2357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2307 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3741 0.1768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9452 -1.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9452 0.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5162 -1.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3741 1.8268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6679 -4.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5491 1.0018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1991 1.0018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3741 -1.4732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 -4.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 -1.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2294 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4924 -4.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0873 -4.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0873 -1.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0552 -3.5645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2294 -3.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2294 -1.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9452 1.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4851 -3.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4851 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2806 -4.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4851 -1.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 6 1 0
6 9 2 0
7 20 1 0
8 11 2 0
9 1 1 0
10 2 1 0
11 4 1 0
12 17 1 0
13 15 1 0
14 5 1 0
15 6 1 0
16 23 1 6
17 21 1 0
18 16 1 0
19 13 1 0
12 20 1 1
21 16 1 0
22 18 1 0
14 23 1 1
24 7 1 0
13 25 1 6
26 7 2 0
27 7 2 0
17 28 1 6
29 4 2 0
30 3 2 0
31 8 1 0
32 25 2 0
33 9 1 0
34 10 1 0
13 35 1 1
36 11 1 0
37 31 1 0
22 38 1 1
39 36 2 0
40 39 1 0
41 25 1 0
42 37 1 0
5 10 2 0
3 8 1 0
14 19 1 0
31 40 2 0
22 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.59Molecular Weight (Monoisotopic): 607.1360AlogP: 0.86#Rotatable Bonds: 6Polar Surface Area: 229.21Molecular Species: ZWITTERIONHBA: 13HBD: 5#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: -2.13CX Basic pKa: 8.92CX LogP: 1.37CX LogD: 1.26Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: 1.78
References 1. Leenders RG, Scheeren HW, Houba PH, Boven E, Haisma HJ. (1995) Synthesis and evaluation of novel daunomycin-phosphate-sulfate --glucuronide and --glucoside prodrugs for application in adept, 5 (24): [10.1016/0960-894X(95)00523-3 ]