2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-{[({[(phosphonatooxy)phosphinato]oxy}(sulfanidyl)phosphoryl)oxy]methyl}oxolan-2-yl]-7-methyl-6-oxido-9H-purin-7-ium

ID: ALA3351004

PubChem CID: 145948197

Max Phase: Preclinical

Molecular Formula: C11H18N5O13P3S

Molecular Weight: 553.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[n+]1cn([C@@H]2O[C@H](CO[P@](=O)(S)OP(=O)([O-])OP(=O)(O)O)[C@@H](O)[C@H]2O)c2nc(N)nc(O)c21

Standard InChI:  InChI=1S/C11H18N5O13P3S/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(27-10)2-26-32(25,33)29-31(23,24)28-30(20,21)22/h3-4,6-7,10,17-18H,2H2,1H3,(H6-,12,13,14,19,20,21,22,23,24,25,33)/t4-,6-,7-,10-,32+/m1/s1

Standard InChI Key:  OTIKKVINVWNBOQ-FGPCVGTKSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   10.9865  -16.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2452  -16.0710    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    9.5609  -16.5319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8196  -16.1699    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.1354  -16.6308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3941  -16.2687    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.7099  -16.7297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2407  -16.8961    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.8115  -16.9961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3865  -17.0961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2188  -15.2464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8115  -15.3461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3865  -15.4461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4087  -17.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2336  -17.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1623  -16.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1718  -14.8719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6822  -15.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9521  -15.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9464  -15.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6587  -16.3742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3773  -15.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3790  -15.1345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6661  -14.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6682  -13.8965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0901  -16.3802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9218  -14.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4978  -16.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7245  -17.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5060  -17.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7078  -16.4552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1787  -18.0042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4782  -18.5786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  2  0
 18 16  1  0
  4  5  1  0
  6 10  1  0
 19 20  2  0
  2  3  1  0
 20 21  1  0
  2 11  2  0
 21 22  2  0
  5  6  1  0
 22 23  1  0
  4 12  2  0
 23 24  2  0
 24 19  1  0
  1  2  1  0
 24 25  1  0
  6 13  2  0
 22 26  1  0
  6  7  1  0
 17 27  1  0
  3  4  1  0
 29 30  1  0
  2  8  1  1
 16 20  1  0
 30 28  1  0
 28 31  1  0
 31 15  1  0
 15 29  1  0
  4  9  1  0
 30 32  1  6
 19 17  1  0
 29 33  1  6
 28 16  1  1
 15 14  1  1
 14  1  1  0
M  CHG  2   9  -1  17   1
M  END

Alternative Forms

  1. Parent:

    ALA3351004

    ---
  2. Alternative Forms:

    ALA3351004

    ---

Associated Targets(non-human)

Eif4e Eukaryotic translation initiation factor 4E (654 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EIF4E Eukaryotic translation initiation factor 4E (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 553.28Molecular Weight (Monoisotopic): 552.9835AlogP: -2.19#Rotatable Bonds: 8
Polar Surface Area: 272.95Molecular Species: ACIDHBA: 15HBD: 7
#RO5 Violations: 3HBA (Lipinski): 18HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 0.66CX Basic pKa: 2.12CX LogP: -7.28CX LogD: -11.22
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.10Np Likeness Score: 0.94

References

1. Kowalska J, Lukaszewicz M, Zuberek J, Ziemniak M, Darzynkiewicz E, Jemielity J..  (2009)  Phosphorothioate analogs of m7GTP are enzymatically stable inhibitors of cap-dependent translation.,  19  (7): [PMID:19269171] [10.1016/j.bmcl.2009.02.053]

Source