The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-aminobenzo[d]thiazol-2-ylthio)-N-(5-(3-methylbenzylthio)-1,3,4-thiadiazol-2-yl)acetamide ID: ALA3352902
PubChem CID: 3948652
Max Phase: Preclinical
Molecular Formula: C19H17N5OS4
Molecular Weight: 459.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CSc2nnc(NC(=O)CSc3nc4ccc(N)cc4s3)s2)c1
Standard InChI: InChI=1S/C19H17N5OS4/c1-11-3-2-4-12(7-11)9-26-19-24-23-17(29-19)22-16(25)10-27-18-21-14-6-5-13(20)8-15(14)28-18/h2-8H,9-10,20H2,1H3,(H,22,23,25)
Standard InChI Key: VEYFCRPXPCFIFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
0.0357 -5.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0346 -5.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7426 -6.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7408 -4.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4495 -5.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4497 -5.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2327 -6.0842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7164 -5.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2323 -4.7523 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5336 -5.4177 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9424 -6.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7596 -6.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1685 -6.8326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1680 -5.4172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9852 -5.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4633 -6.0786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2404 -5.8258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2402 -5.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4629 -4.7564 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9011 -4.5279 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6478 -4.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3087 -4.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0541 -4.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7146 -4.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6292 -3.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8776 -3.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2202 -3.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4612 -4.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6734 -4.6020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
24 28 1 0
1 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.65Molecular Weight (Monoisotopic): 459.0316AlogP: 5.06#Rotatable Bonds: 7Polar Surface Area: 93.79Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.84CX Basic pKa: 2.80CX LogP: 5.10CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.23Np Likeness Score: -2.79
References 1. Hou X, Li R, Li K, Yu X, Sun JP, Fang H.. (2014) Fast identification of novel lymphoid tyrosine phosphatase inhibitors using target-ligand interaction-based virtual screening., 57 (22): [PMID:25372368 ] [10.1021/jm500692u ]