The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-benzoyl-1,4-diazepan-1-yl)propyl 3,4,5-trimethoxybenzoate ID: ALA3353075
PubChem CID: 50944048
Max Phase: Preclinical
Molecular Formula: C25H32N2O6
Molecular Weight: 456.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)OCCCN2CCCN(C(=O)c3ccccc3)CC2)cc(OC)c1OC
Standard InChI: InChI=1S/C25H32N2O6/c1-30-21-17-20(18-22(31-2)23(21)32-3)25(29)33-16-8-12-26-11-7-13-27(15-14-26)24(28)19-9-5-4-6-10-19/h4-6,9-10,17-18H,7-8,11-16H2,1-3H3
Standard InChI Key: UPLSSZAEUBFQTR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
8.9157 -12.7444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7989 -13.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0829 -12.8061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3838 -13.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6678 -12.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4008 -14.0463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9731 -13.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2575 -12.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2401 -12.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9441 -11.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6568 -12.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5587 -13.2906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5760 -14.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5246 -11.6544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8249 -12.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9301 -10.8089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2154 -10.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4980 -12.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2141 -13.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8371 -11.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4265 -11.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6057 -13.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2400 -11.4543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3853 -12.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6647 -12.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6837 -10.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3112 -10.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4999 -10.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8673 -11.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6827 -11.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1272 -10.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7504 -10.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9362 -10.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
5 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 5 1 0
8 12 1 0
12 13 1 0
9 14 1 0
14 15 1 0
10 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
19 1 1 0
1 20 1 0
20 21 1 0
1 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 25 1 0
23 26 1 0
26 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.54Molecular Weight (Monoisotopic): 456.2260AlogP: 3.11#Rotatable Bonds: 9Polar Surface Area: 77.54Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.07CX LogP: 2.57CX LogD: 1.82Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -0.91
References 1. Playa H, Lewis TA, Ting A, Suh BC, Muñoz B, Matuza R, Passer BJ, Schreiber SL, Buolamwini JK.. (2014) Dilazep analogues for the study of equilibrative nucleoside transporters 1 and 2 (ENT1 and ENT2)., 24 (24): [PMID:25454272 ] [10.1016/j.bmcl.2014.10.026 ]