The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(3,3'-(1,4-diazepane-1,4-diyl)bis(propane-3,1-diyl))bis(3,4,5-trimethoxybenzamide) ID: ALA3353077
PubChem CID: 15728777
Max Phase: Preclinical
Molecular Formula: C31H46N4O8
Molecular Weight: 602.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NCCCN2CCCN(CCCNC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC
Standard InChI: InChI=1S/C31H46N4O8/c1-38-24-18-22(19-25(39-2)28(24)42-5)30(36)32-10-7-12-34-14-9-15-35(17-16-34)13-8-11-33-31(37)23-20-26(40-3)29(43-6)27(21-23)41-4/h18-21H,7-17H2,1-6H3,(H,32,36)(H,33,37)
Standard InChI Key: PJPAIMWSKBWYCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
5.6717 -7.1809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5549 -7.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8389 -7.2426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1398 -7.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4238 -7.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1568 -8.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7291 -7.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0135 -7.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0043 -6.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7001 -6.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4128 -6.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6932 -7.7271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6693 -8.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7251 -6.0909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4205 -6.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6860 -5.2454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0292 -4.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2540 -7.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9701 -7.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5931 -6.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1825 -5.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3617 -7.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 -5.8908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1413 -7.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4207 -6.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4397 -5.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2559 -5.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6995 -4.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5157 -4.6004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9593 -3.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7755 -3.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5868 -3.1868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1461 -4.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9614 -4.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4059 -4.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0292 -3.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2149 -3.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4704 -2.6201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2867 -2.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2221 -4.0779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5956 -4.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3336 -5.4522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8896 -6.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
5 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 5 1 0
8 12 1 0
12 13 1 0
9 14 1 0
14 15 1 0
10 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
19 1 1 0
1 20 1 0
20 21 1 0
1 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
36 38 1 0
38 39 1 0
35 40 1 0
40 41 1 0
34 42 1 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.73Molecular Weight (Monoisotopic): 602.3316AlogP: 2.69#Rotatable Bonds: 16Polar Surface Area: 120.06Molecular Species: BASEHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.95CX LogP: 1.02CX LogD: -0.53Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.28Np Likeness Score: -0.54
References 1. Playa H, Lewis TA, Ting A, Suh BC, Muñoz B, Matuza R, Passer BJ, Schreiber SL, Buolamwini JK.. (2014) Dilazep analogues for the study of equilibrative nucleoside transporters 1 and 2 (ENT1 and ENT2)., 24 (24): [PMID:25454272 ] [10.1016/j.bmcl.2014.10.026 ]