The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(amino(iminio)methylamino)-N-(8-(iminio(2-methylallylamino)methylamino)octyl)octan-1-aminium 2,2,2-trifluoroacetate ID: ALA3353612
PubChem CID: 44222833
Max Phase: Preclinical
Molecular Formula: C28H50F9N7O6
Molecular Weight: 409.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)CNC(=N)NCCCCCCCCNCCCCCCCCNC(=N)N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C22H47N7.3C2HF3O2/c1-20(2)19-29-22(25)28-18-14-10-6-4-8-12-16-26-15-11-7-3-5-9-13-17-27-21(23)24;3*3-2(4,5)1(6)7/h26H,1,3-19H2,2H3,(H4,23,24,27)(H3,25,28,29);3*(H,6,7)
Standard InChI Key: NFSBYQYQCPYFQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
50 46 0 0 0 0 0 0 0 0999 V2000
14.1136 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8213 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5290 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2367 -5.4810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9444 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6521 -5.4810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9444 -6.7067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2056 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9134 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4979 -5.4810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7902 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0825 -5.4810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7902 -6.7067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6211 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3288 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0365 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7442 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4519 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1596 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8673 -5.8896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5750 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2827 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9904 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6981 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4059 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3598 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0675 -5.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7752 -5.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0675 -4.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8342 -8.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5419 -8.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -8.5269 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8342 -9.7526 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1243 -9.3399 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2496 -8.9354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5419 -7.7097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6342 -8.7869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3419 -8.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9265 -8.3783 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6342 -9.6041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9243 -9.1913 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0496 -8.7869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3419 -7.5611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4300 -8.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1377 -8.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7223 -8.0068 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4300 -9.2326 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7201 -8.8199 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8454 -8.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1377 -7.1896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
8 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 1 1 0
6 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
30 31 1 0
30 32 1 0
30 33 1 0
30 34 1 0
31 35 1 0
31 36 2 0
37 38 1 0
37 39 1 0
37 40 1 0
37 41 1 0
38 42 1 0
38 43 2 0
44 45 1 0
44 46 1 0
44 47 1 0
44 48 1 0
45 49 1 0
45 50 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.67Molecular Weight (Monoisotopic): 409.3893AlogP: 3.43#Rotatable Bonds: 20Polar Surface Area: 121.84Molecular Species: BASEHBA: 3HBD: 7#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 12.62CX LogP: 3.51CX LogD: -4.28Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.07Np Likeness Score: 0.22
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]