The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(amino(iminio)methylamino)-N-(8-(iminio(prop-2-ynylamino)methylamino)octyl)octan-1-aminium 2,2,2-trifluoroacetate ID: ALA3353614
PubChem CID: 135878392
Max Phase: Preclinical
Molecular Formula: C27H46F9N7O6
Molecular Weight: 393.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCNC(=N)NCCCCCCCCNCCCCCCCCNC(=N)N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H43N7.3C2HF3O2/c1-2-15-27-21(24)28-19-14-10-6-4-8-12-17-25-16-11-7-3-5-9-13-18-26-20(22)23;3*3-2(4,5)1(6)7/h1,25H,3-19H2,(H4,22,23,26)(H3,24,27,28);3*(H,6,7)
Standard InChI Key: NOMMTCKIODZFRG-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 45 0 0 0 0 0 0 0 0999 V2000
13.3898 -6.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0976 -5.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6821 -5.6227 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.3898 -6.8485 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6800 -6.4358 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8053 -6.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0976 -4.8055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5853 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2930 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0007 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7084 -1.8284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4161 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1238 -1.8284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4161 -3.0541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3851 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9697 -1.8284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2619 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5542 -1.8284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2619 -3.0541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0928 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8005 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5082 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2159 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9236 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6313 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3390 -2.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0467 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7544 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4622 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1699 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8776 -1.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1238 -1.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8315 -0.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5374 -0.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0377 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7454 -5.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3300 -5.3114 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0377 -6.5372 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3278 -6.1245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4531 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7454 -4.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4329 -5.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1406 -5.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7252 -5.2596 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4329 -6.4853 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7230 -6.0726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8483 -5.6682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1406 -4.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 1 0
2 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
15 16 1 0
15 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 8 1 0
13 33 1 0
33 34 1 0
34 35 3 0
36 37 1 0
36 38 1 0
36 39 1 0
36 40 1 0
37 41 1 0
37 42 2 0
43 44 1 0
43 45 1 0
43 46 1 0
43 47 1 0
44 48 1 0
44 49 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.62Molecular Weight (Monoisotopic): 393.3580AlogP: 2.49#Rotatable Bonds: 19Polar Surface Area: 121.84Molecular Species: BASEHBA: 3HBD: 7#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 12.36CX LogP: 2.76CX LogD: -5.03Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.08Np Likeness Score: -0.07
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]