The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(8-((but-2-enylamino)(iminio)methylamino)octyl)-4-oxo-1,3,5-triazacyclotridecan-2-iminium 2,2,2-trifluoroacetate ID: ALA3353618
PubChem CID: 145948286
Max Phase: Preclinical
Molecular Formula: C27H47F6N7O5
Molecular Weight: 435.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/CNC(=N)NCCCCCCCCN1CCCCCCCCNC(=N)NC1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C23H45N7O.2C2HF3O2/c1-2-3-16-26-21(24)27-17-12-8-4-6-10-14-19-30-20-15-11-7-5-9-13-18-28-22(25)29-23(30)31;2*3-2(4,5)1(6)7/h2-3H,4-20H2,1H3,(H3,24,26,27)(H3,25,28,29,31);2*(H,6,7)/b3-2+;;
Standard InChI Key: PESGOJQSKIREFG-WTVBWJGASA-N
Molfile:
RDKit 2D
45 43 0 0 0 0 0 0 0 0999 V2000
2.8436 -5.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8232 -5.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6068 -5.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0399 -5.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8405 -4.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8153 -4.8920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8405 -4.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8528 -3.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6074 -3.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9941 -3.8290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6656 -3.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0126 -3.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3716 -2.7785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5547 -3.4482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6963 -2.5931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4583 -5.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2166 -5.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8595 -5.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6178 -5.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2608 -5.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0191 -5.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6621 -5.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4203 -5.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0633 -6.1950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8216 -5.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4646 -6.3946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9369 -5.0813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2229 -6.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8659 -6.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6241 -6.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2671 -6.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -7.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5271 -7.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1117 -7.3547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -8.5805 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1095 -8.1678 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2348 -7.7633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5271 -6.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1819 -8.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8896 -8.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4742 -8.5021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1819 -9.7279 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4720 -9.3152 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5973 -8.9107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8896 -7.6849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 7 1 0
6 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 12 1 0
11 13 1 0
12 13 1 0
1 2 1 0
8 14 2 0
12 15 2 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
32 33 1 0
32 34 1 0
32 35 1 0
32 36 1 0
33 37 1 0
33 38 2 0
39 40 1 0
39 41 1 0
39 42 1 0
39 43 1 0
40 44 1 0
40 45 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.66Molecular Weight (Monoisotopic): 435.3686AlogP: 3.91#Rotatable Bonds: 11Polar Surface Area: 116.13Molecular Species: BASEHBA: 3HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.31CX Basic pKa: 12.39CX LogP: 3.49CX LogD: 1.41Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.13Np Likeness Score: 0.13
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]