The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(8-((cyclobutylmethylamino)(iminio)methylamino)octyl)-4-oxo-1,3,5-triazacyclotridecan-2-iminium 2,2,2-trifluoroacetate ID: ALA3353619
PubChem CID: 145948285
Max Phase: Preclinical
Molecular Formula: C28H49F6N7O5
Molecular Weight: 449.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(NCCCCCCCCN1CCCCCCCCNC(=N)NC1=O)NCC1CCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C24H47N7O.2C2HF3O2/c25-22(29-20-21-14-13-15-21)27-16-9-5-1-3-7-11-18-31-19-12-8-4-2-6-10-17-28-23(26)30-24(31)32;2*3-2(4,5)1(6)7/h21H,1-20H2,(H3,25,27,29)(H3,26,28,30,32);2*(H,6,7)
Standard InChI Key: VQVPFAZZBBAUHH-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 45 0 0 0 0 0 0 0 0999 V2000
3.7846 -6.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7642 -6.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5478 -5.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9809 -5.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7815 -5.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7563 -5.1314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7815 -4.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7938 -4.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5484 -4.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9351 -4.0684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6066 -3.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9536 -3.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3127 -3.0179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4957 -3.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6373 -2.8324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3993 -5.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1576 -5.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8006 -5.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5588 -5.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2018 -6.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9601 -5.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6031 -6.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3614 -5.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0043 -6.4343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7626 -6.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4056 -6.6340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8779 -5.3206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1639 -6.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8069 -6.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9017 -7.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7130 -7.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6150 -6.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -7.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5271 -7.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1117 -7.3547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -8.5805 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1095 -8.1678 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2348 -7.7633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5271 -6.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1819 -8.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8896 -8.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4742 -8.5021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1819 -9.7279 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4720 -9.3152 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5973 -8.9107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8896 -7.6849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 7 1 0
6 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 12 1 0
11 13 1 0
12 13 1 0
1 2 1 0
8 14 2 0
12 15 2 0
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 29 1 0
33 34 1 0
33 35 1 0
33 36 1 0
33 37 1 0
34 38 1 0
34 39 2 0
40 41 1 0
40 42 1 0
40 43 1 0
40 44 1 0
41 45 1 0
41 46 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.69Molecular Weight (Monoisotopic): 449.3842AlogP: 4.13#Rotatable Bonds: 11Polar Surface Area: 116.13Molecular Species: BASEHBA: 3HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.33CX Basic pKa: 12.65CX LogP: 3.62CX LogD: 1.51Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.16
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]