The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6-((but-2-enylamino)(iminio)methylamino)hexyl)-4-oxo-1,3,5-triazacyclotridecan-2-iminium 2,2,2-trifluoroacetate ID: ALA3353622
PubChem CID: 145948288
Max Phase: Preclinical
Molecular Formula: C25H43F6N7O5
Molecular Weight: 407.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/CNC(=N)NCCCCCCN1CCCCCCCCNC(=N)NC1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H41N7O.2C2HF3O2/c1-2-3-14-24-19(22)25-15-11-7-9-13-18-28-17-12-8-5-4-6-10-16-26-20(23)27-21(28)29;2*3-2(4,5)1(6)7/h2-3H,4-18H2,1H3,(H3,22,24,25)(H3,23,26,27,29);2*(H,6,7)/b3-2+;;
Standard InChI Key: WTTYBROWOWXHIL-WTVBWJGASA-N
Molfile:
RDKit 2D
43 41 0 0 0 0 0 0 0 0999 V2000
14.3755 -2.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0832 -2.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6678 -2.5620 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.3755 -3.7877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.6656 -3.3750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7909 -2.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0832 -1.7448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7199 -7.6214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4781 -7.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1211 -7.8211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5934 -6.5077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8794 -7.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5224 -8.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2807 -7.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9014 -7.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8810 -7.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6646 -6.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0977 -6.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8983 -6.4960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8731 -6.5181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8983 -5.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9105 -5.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6651 -5.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0519 -5.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7234 -4.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0704 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4294 -4.4046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6125 -5.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7541 -4.2192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5161 -7.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2743 -6.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9173 -7.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6756 -6.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3186 -7.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0769 -7.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9236 -8.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9947 -2.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7024 -1.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2869 -1.8876 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9947 -3.1134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2848 -2.7006 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4101 -2.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7024 -1.0704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 1 0
2 7 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
25 27 1 0
26 27 1 0
15 16 1 0
22 28 2 0
26 29 2 0
20 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 8 1 0
14 36 1 0
37 38 1 0
37 39 1 0
37 40 1 0
37 41 1 0
38 42 1 0
38 43 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.61Molecular Weight (Monoisotopic): 407.3373AlogP: 3.13#Rotatable Bonds: 9Polar Surface Area: 116.13Molecular Species: BASEHBA: 3HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.29CX Basic pKa: 12.21CX LogP: 2.58CX LogD: 0.52Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.15Np Likeness Score: 0.14
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]