The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6-(iminio(prop-2-ynylamino)methylamino)hexyl)-4-oxo-1,3,5-triazacyclotridecan-2-iminium 2,2,2-trifluoroacetate ID: ALA3353625
PubChem CID: 145948313
Max Phase: Preclinical
Molecular Formula: C24H39F6N7O5
Molecular Weight: 391.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCNC(=N)NCCCCCCN1CCCCCCCCNC(=N)NC1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C20H37N7O.2C2HF3O2/c1-2-13-23-18(21)24-14-10-6-8-12-17-27-16-11-7-4-3-5-9-15-25-19(22)26-20(27)28;2*3-2(4,5)1(6)7/h1H,3-17H2,(H3,21,23,24)(H3,22,25,26,28);2*(H,6,7)
Standard InChI Key: YRHJYUKPZVGSBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 40 0 0 0 0 0 0 0 0999 V2000
28.7454 -8.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4531 -8.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0377 -8.5797 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.7454 -9.8055 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.0355 -9.3927 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.1608 -8.9883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4531 -7.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3550 -13.1272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1133 -12.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7563 -13.3268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2285 -12.0135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5145 -13.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1575 -13.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5366 -13.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5161 -13.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2997 -12.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7328 -12.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5334 -12.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5082 -12.0238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5334 -11.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5457 -11.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3003 -10.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6871 -10.9608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3585 -10.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7055 -10.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0646 -9.9103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2477 -10.5800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3893 -9.7249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1512 -12.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9095 -12.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5525 -12.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3107 -12.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9537 -12.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7120 -12.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8013 -14.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8314 -8.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5391 -8.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1237 -8.4240 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.8314 -9.6498 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.1216 -9.2371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.2469 -8.8326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5391 -7.6069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 1 0
2 7 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
14 16 1 0
15 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
25 26 1 0
14 15 1 0
21 27 2 0
25 28 2 0
19 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 8 1 0
13 35 3 0
36 37 1 0
36 38 1 0
36 39 1 0
36 40 1 0
37 41 1 0
37 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 391.56Molecular Weight (Monoisotopic): 391.3060AlogP: 2.18#Rotatable Bonds: 8Polar Surface Area: 116.13Molecular Species: BASEHBA: 3HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.10CX Basic pKa: 11.71CX LogP: 1.61CX LogD: -0.36Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.16Np Likeness Score: -0.46
References 1. Maccari G, Sanfilippo S, De Luca F, Deodato D, Casian A, Dasso Lang MC, Zamperini C, Dreassi E, Rossolini GM, Docquier JD, Botta M.. (2014) Synthesis of linear and cyclic guazatine derivatives endowed with antibacterial activity., 24 (23): [PMID:25455183 ] [10.1016/j.bmcl.2014.09.081 ]