(S)-4-(3-chloro-4-methoxybenzylamino)-2-(3-(hydroxymethyl)-3,4-dihydroisoquinolin-2(1H)-yl)-N-(pyridin-2-ylmethyl)pyrimidine-5-carboxamide

ID: ALA3354278

PubChem CID: 118720071

Max Phase: Preclinical

Molecular Formula: C29H29ClN6O3

Molecular Weight: 545.04

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNc2nc(N3Cc4ccccc4C[C@H]3CO)ncc2C(=O)NCc2ccccn2)cc1Cl

Standard InChI:  InChI=1S/C29H29ClN6O3/c1-39-26-10-9-19(12-25(26)30)14-32-27-24(28(38)33-15-22-8-4-5-11-31-22)16-34-29(35-27)36-17-21-7-3-2-6-20(21)13-23(36)18-37/h2-12,16,23,37H,13-15,17-18H2,1H3,(H,33,38)(H,32,34,35)/t23-/m0/s1

Standard InChI Key:  WDBFSZFOLCDJAC-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    4.5273   -5.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5240   -5.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2383   -6.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9533   -5.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9492   -5.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2344   -4.6332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6618   -4.6247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6575   -3.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3699   -3.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6689   -6.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6714   -7.1057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3824   -5.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0816   -3.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7936   -3.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7897   -2.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0681   -2.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3591   -2.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5016   -2.1369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2188   -2.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5099   -3.7893    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.3871   -7.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3895   -8.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6757   -8.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6777   -9.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3941   -9.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1097   -9.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1042   -8.7452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8120   -4.6379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8159   -3.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1047   -3.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1040   -5.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5316   -3.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5337   -2.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3882   -4.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3919   -3.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6799   -3.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9637   -3.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9640   -4.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6766   -5.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
 15 18  1  0
 18 19  1  0
 14 20  1  0
 11 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  1 28  1  0
 28 29  1  0
 28 31  1  0
 29 30  1  0
 30 35  1  0
 34 31  1  0
 29 32  1  1
 32 33  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3354278

    ---

Associated Targets(non-human)

PDE5A Phosphodiesterase 5A (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.04Molecular Weight (Monoisotopic): 544.1990AlogP: 4.00#Rotatable Bonds: 9
Polar Surface Area: 112.50Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.83CX Basic pKa: 5.52CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.29

References

1. Sakamoto T, Koga Y, Hikota M, Matsuki K, Murakami M, Kikkawa K, Fujishige K, Kotera J, Omori K, Morimoto H, Yamada K..  (2014)  The discovery of avanafil for the treatment of erectile dysfunction: a novel pyrimidine-5-carboxamide derivative as a potent and highly selective phosphodiesterase 5 inhibitor.,  24  (23): [PMID:25455484] [10.1016/j.bmcl.2014.10.008]

Source