4-(3-chloro-4-methoxybenzylamino)-2-(3-(hydroxymethyl)pyrrolidin-1-yl)-N-(pyrimidin-2-ylmethyl)pyrimidine-5-carboxamide

ID: ALA3354282

PubChem CID: 118720074

Max Phase: Preclinical

Molecular Formula: C23H26ClN7O3

Molecular Weight: 483.96

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNc2nc(N3CCC(CO)C3)ncc2C(=O)NCc2ncccn2)cc1Cl

Standard InChI:  InChI=1S/C23H26ClN7O3/c1-34-19-4-3-15(9-18(19)24)10-27-21-17(22(33)28-12-20-25-6-2-7-26-20)11-29-23(30-21)31-8-5-16(13-31)14-32/h2-4,6-7,9,11,16,32H,5,8,10,12-14H2,1H3,(H,28,33)(H,27,29,30)

Standard InChI Key:  XQOKKJNLZLOKLR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    0.9936  -11.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9902  -12.1968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7044  -12.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4193  -12.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4153  -11.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7005  -10.9576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1277  -10.9490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1234  -10.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8357   -9.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1349  -12.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1372  -13.4298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8482  -12.1902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5473  -10.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2592   -9.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2554   -8.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5338   -8.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249   -8.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9672   -8.4616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6843   -8.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9756  -10.1137    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.8529  -13.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8553  -14.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1416  -15.0754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1436  -15.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8599  -16.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5754  -15.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5699  -15.0690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2782  -10.9622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1859  -10.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6285   -9.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0341  -10.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4874  -11.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8554  -10.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3442  -10.1084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
 15 18  1  0
 18 19  1  0
 14 20  1  0
 11 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  1 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 31 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3354282

    ---

Associated Targets(non-human)

PDE5A Phosphodiesterase 5A (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.96Molecular Weight (Monoisotopic): 483.1786AlogP: 2.29#Rotatable Bonds: 9
Polar Surface Area: 125.39Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.73CX Basic pKa: 6.59CX LogP: 2.43CX LogD: 2.42
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.59

References

1. Sakamoto T, Koga Y, Hikota M, Matsuki K, Murakami M, Kikkawa K, Fujishige K, Kotera J, Omori K, Morimoto H, Yamada K..  (2014)  The discovery of avanafil for the treatment of erectile dysfunction: a novel pyrimidine-5-carboxamide derivative as a potent and highly selective phosphodiesterase 5 inhibitor.,  24  (23): [PMID:25455484] [10.1016/j.bmcl.2014.10.008]

Source