The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-morpholino-2-(3-(naphthalene-1-sulfonamido)phenyl)quinazolin-6-yl)acetamide ID: ALA3354564
PubChem CID: 118720258
Max Phase: Preclinical
Molecular Formula: C30H27N5O4S
Molecular Weight: 553.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc2nc(-c3cccc(NS(=O)(=O)c4cccc5ccccc45)c3)nc(N3CCOCC3)c2c1
Standard InChI: InChI=1S/C30H27N5O4S/c1-20(36)31-23-12-13-27-26(19-23)30(35-14-16-39-17-15-35)33-29(32-27)22-8-4-9-24(18-22)34-40(37,38)28-11-5-7-21-6-2-3-10-25(21)28/h2-13,18-19,34H,14-17H2,1H3,(H,31,36)
Standard InChI Key: KGXGQVMIUTXLRP-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
8.9643 -5.3695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5599 -4.6638 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1509 -5.3669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1984 -3.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1973 -4.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9053 -4.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9035 -3.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4906 -3.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4904 -2.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7826 -1.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1980 -1.8366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6121 -3.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6129 -4.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3214 -4.6934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0297 -4.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0249 -3.4605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3158 -3.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3141 -2.2419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0214 -1.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0190 -1.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3110 -0.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6036 -1.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6044 -1.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7354 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7373 -5.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4457 -5.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1528 -5.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1470 -4.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4380 -4.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8517 -4.2618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2670 -4.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6799 -3.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9642 -3.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2604 -3.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6831 -4.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9779 -4.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9787 -5.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6839 -5.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3899 -5.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3856 -4.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 13 2 0
12 7 2 0
7 4 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
17 18 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
15 24 1 0
28 30 1 0
30 2 1 0
2 31 1 0
31 36 2 0
35 32 2 0
32 33 1 0
33 34 2 0
34 31 1 0
35 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.64Molecular Weight (Monoisotopic): 553.1784AlogP: 5.05#Rotatable Bonds: 6Polar Surface Area: 113.52Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.45CX Basic pKa: 4.82CX LogP: 5.21CX LogD: 4.97Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -1.86
References 1. Mountford SJ, Zheng Z, Sundaram K, Jennings IG, Hamilton JR, Thompson PE.. (2015) Class II but Not Second Class-Prospects for the Development of Class II PI3K Inhibitors., 6 (1): [PMID:25589915 ] [10.1021/ml500354e ]