N-(4-morpholino-2-(3-(phenylsulfonamido)phenyl)quinazolin-6-yl)acetamide

ID: ALA3354565

PubChem CID: 10141912

Max Phase: Preclinical

Molecular Formula: C26H25N5O4S

Molecular Weight: 503.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc2nc(-c3cccc(NS(=O)(=O)c4ccccc4)c3)nc(N3CCOCC3)c2c1

Standard InChI:  InChI=1S/C26H25N5O4S/c1-18(32)27-20-10-11-24-23(17-20)26(31-12-14-35-15-13-31)29-25(28-24)19-6-5-7-21(16-19)30-36(33,34)22-8-3-2-4-9-22/h2-11,16-17,30H,12-15H2,1H3,(H,27,32)

Standard InChI Key:  APSUSKFJHUBJPP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   19.4227   -5.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0183   -4.6885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.6093   -5.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6568   -3.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6556   -4.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3637   -4.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3619   -3.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9490   -3.0873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9488   -2.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2410   -1.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6564   -1.8613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0705   -3.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0713   -4.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7798   -4.7182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4881   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4833   -3.4853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7742   -3.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7725   -2.2666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4798   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4774   -1.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7694   -0.6332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0620   -1.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0628   -1.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1938   -4.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1957   -5.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9041   -5.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6112   -5.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6054   -4.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8964   -4.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3100   -4.2866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7254   -4.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1383   -3.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4226   -3.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7188   -3.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1415   -4.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4363   -4.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6 13  2  0
 12  7  2  0
  7  4  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 17 18  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 15 24  1  0
 28 30  1  0
 30  2  1  0
  2 31  1  0
 31 36  2  0
 35 32  2  0
 32 33  1  0
 33 34  2  0
 34 31  1  0
 35 36  1  0
M  END

Associated Targets(Human)

PIK3C2B Tchem Phosphatidylinositol-4-phosphate 3-kinase C2 domain-containing beta polypeptide (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3C2A Tchem Phosphatidylinositol-4-phosphate 3-kinase C2 domain-containing subunit alpha (139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3C2G Tchem Phosphatidylinositol-4-phosphate 3-kinase C2 domain-containing subunit gamma (327 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.58Molecular Weight (Monoisotopic): 503.1627AlogP: 3.89#Rotatable Bonds: 6
Polar Surface Area: 113.52Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.77CX Basic pKa: 4.82CX LogP: 4.21CX LogD: 4.07
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -2.03

References

1. Mountford SJ, Zheng Z, Sundaram K, Jennings IG, Hamilton JR, Thompson PE..  (2015)  Class II but Not Second Class-Prospects for the Development of Class II PI3K Inhibitors.,  (1): [PMID:25589915] [10.1021/ml500354e]
2. Falasca M, Hamilton JR, Selvadurai M, Sundaram K, Adamska A, Thompson PE..  (2017)  Class II Phosphoinositide 3-Kinases as Novel Drug Targets.,  60  (1): [PMID:27644332] [10.1021/acs.jmedchem.6b00963]

Source