The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(3-methyl-2-oxo-8-(quinolin-3-yl)-2,3-dihydro-1H-imidazo[4,5-c]quinolin-1-yl)phenyl)cyclopropanecarbonitrile ID: ALA3354566
PubChem CID: 11979157
Max Phase: Preclinical
Molecular Formula: C30H21N5O
Molecular Weight: 467.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(=O)n(-c2ccc(C3(C#N)CC3)cc2)c2c3cc(-c4cnc5ccccc5c4)ccc3ncc21
Standard InChI: InChI=1S/C30H21N5O/c1-34-27-17-33-26-11-6-19(21-14-20-4-2-3-5-25(20)32-16-21)15-24(26)28(27)35(29(34)36)23-9-7-22(8-10-23)30(18-31)12-13-30/h2-11,14-17H,12-13H2,1H3
Standard InChI Key: MPZUHFMONDTNMH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
11.5521 -12.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5562 -13.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2619 -13.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9559 -16.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9547 -16.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6628 -17.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6610 -15.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3696 -16.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3704 -16.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0789 -17.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7872 -16.8996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7824 -16.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0733 -15.6741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4929 -17.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4947 -18.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2032 -18.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1955 -16.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9045 -17.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9074 -18.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6179 -18.5183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3259 -18.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6080 -16.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3181 -17.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9179 -16.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5784 -15.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7689 -16.0811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9794 -15.2751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7190 -16.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2165 -15.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4623 -14.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9097 -14.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1113 -14.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8684 -15.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4226 -15.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7600 -13.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9649 -14.0420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
11 14 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 23 1 0
22 18 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
25 27 2 0
24 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
32 2 1 0
2 35 1 0
35 36 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.53Molecular Weight (Monoisotopic): 467.1746AlogP: 5.65#Rotatable Bonds: 3Polar Surface Area: 76.50Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.07CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.87
References 1. Mountford SJ, Zheng Z, Sundaram K, Jennings IG, Hamilton JR, Thompson PE.. (2015) Class II but Not Second Class-Prospects for the Development of Class II PI3K Inhibitors., 6 (1): [PMID:25589915 ] [10.1021/ml500354e ]