4-chloro-N-(5-((4-hydroxy-2-oxo-3-phenylcyclopent-3-en-1-yl)methyl)-1,2,3,4-tetrahydro naphthalen-2-yl)benzenesulfonamide

ID: ALA3354614

PubChem CID: 117630548

Max Phase: Preclinical

Molecular Formula: C28H26ClNO4S

Molecular Weight: 508.04

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C(c2ccccc2)=C(O)CC1Cc1cccc2c1CCC(NS(=O)(=O)c1ccc(Cl)cc1)C2

Standard InChI:  InChI=1S/C28H26ClNO4S/c29-22-9-12-24(13-10-22)35(33,34)30-23-11-14-25-19(7-4-8-20(25)16-23)15-21-17-26(31)27(28(21)32)18-5-2-1-3-6-18/h1-10,12-13,21,23,30-31H,11,14-17H2

Standard InChI Key:  DGGMGXRMNVQDPS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   11.5252   -8.5321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1643   -9.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3644  -11.2970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0755  -10.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8348   -9.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9500   -9.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8952  -10.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5104   -9.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2912   -6.9578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8719   -6.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1612   -5.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8346   -7.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0028   -7.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1272   -6.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7388   -5.7367    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.4561   -6.9716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0028   -8.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1674   -7.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4510   -6.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4211   -8.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5817   -7.3724    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7149   -6.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8369   -8.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7149   -8.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1281   -8.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4227   -7.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1730   -8.0782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9901   -8.0808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8704   -6.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1274   -9.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5507  -10.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3358   -9.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5207   -9.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9143   -8.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1316   -8.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
  8  5  1  0
  7  2  2  0
  5  4  1  0
  2  6  1  0
  2  8  1  0
  8  1  2  0
  7  3  1  0
 13 17  1  0
 16 18  2  0
 19 16  1  0
 27 21  2  0
 17 24  1  0
  9 21  1  0
 29 10  2  0
 13 22  1  0
 26 22  1  0
 24 20  1  0
 11 19  2  0
 14 26  1  0
 23 12  1  0
 13  9  1  0
 25 23  2  0
 19 15  1  0
 21 28  2  0
 18 29  1  0
 21 29  1  0
 12 14  2  0
 20 25  1  0
 10 11  1  0
 26 20  2  0
 25 30  1  0
 30  5  1  0
  6 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35  6  1  0
M  END

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.04Molecular Weight (Monoisotopic): 507.1271AlogP: 5.28#Rotatable Bonds: 6
Polar Surface Area: 83.47Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.65CX Basic pKa: CX LogP: 6.00CX LogD: 5.97
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -0.29

References

1. Wang X, Liu L, Huang L, Herbst-Robinson K, Cornec AS, James MJ, Sugiyama S, Bassetto M, Brancale A, Trojanowski JQ, Lee VM, Smith AB, Brunden KR, Ballatore C..  (2014)  Potent, long-acting cyclopentane-1,3-Dione thromboxane (A2)-receptor antagonists.,  (9): [PMID:25221659] [10.1021/ml5002085]

Source